C23H30F21N3O3 — CID 154981936
1,1,1,3,3,3-hexafluoro-N-[1-[3,3,3-trifluoro-2,2-bis[2-(1,1,1,3,3,3-hexafluoropropan-2-ylamino)propoxymethyl]propoxy]propan-2-yl]propan-2-amine (PubChem CID 154981936) has the molecular formula C23H30F21N3O3 and a molecular weight of 795.47 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoro-N-[1-[3,3,3-trifluoro-2,2-bis[2-(1,1,1,3,3,3-hexafluoropropan-2-ylamino)propoxymethyl]propoxy]propan-2-yl]propan-2-amine.
| Compound Name | 1,1,1,3,3,3-hexafluoro-N-[1-[3,3,3-trifluoro-2,2-bis[2-(1,1,1,3,3,3-hexafluoropropan-2-ylamino)propoxymethyl]propoxy]propan-2-yl]propan-2-amine |
|---|---|
| PubChem CID | 154981936 |
| Molecular Formula | C23H30F21N3O3 |
| Molecular Weight | 795.47 g/mol |
| Exact Mass | 795.20 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoro-N-[1-[3,3,3-trifluoro-2,2-bis[2-(1,1,1,3,3,3-hexafluoropropan-2-ylamino)propoxymethyl]propoxy]propan-2-yl]propan-2-amine |
| SMILES | CC(COCC(COCC(C)NC(C(F)(F)F)C(F)(F)F)(COCC(C)NC(C(F)(F)F)C(F)(F)F)C(F)(F)F)NC(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C23H30F21N3O3/c1-10(45-13(17(24,25)26)18(27,28)29)4-48-7-16(23(42,43)44,8-49-5-11(2)46-14(19(30,31)32)20(33,34)35)9-50-6-12(3)47-15(21(36,37)38)22(39,40)41/h10-15,45-47H,4-9H2,1-3H3 |
| InChIKey | GJLMPEHXYBLPAU-UHFFFAOYSA-N |
| XLogP | 7.00 |
| TPSA | 63.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 795.47 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |