C24H25NO2S — CID 154982071
9H-fluoren-9-ylmethyl N-[2-[(3E,5Z)-hepta-1,3,5-trien-4-yl]sulfanylethyl]carbamate (PubChem CID 154982071) has the molecular formula C24H25NO2S and a molecular weight of 391.54 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-[2-[(3E,5Z)-hepta-1,3,5-trien-4-yl]sulfanylethyl]carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-[2-[(3E,5Z)-hepta-1,3,5-trien-4-yl]sulfanylethyl]carbamate |
|---|---|
| PubChem CID | 154982071 |
| Molecular Formula | C24H25NO2S |
| Molecular Weight | 391.54 g/mol |
| Exact Mass | 391.16 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-[2-[(3E,5Z)-hepta-1,3,5-trien-4-yl]sulfanylethyl]carbamate |
| SMILES | C=C/C=C(\C=C/C)SCCNC(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C24H25NO2S/c1-3-9-18(10-4-2)28-16-15-25-24(26)27-17-23-21-13-7-5-11-19(21)20-12-6-8-14-22(20)23/h3-14,23H,1,15-17H2,2H3,(H,25,26)/b10-4-,18-9+ |
| InChIKey | CIMNUIUKJKSDHY-WPAOCOIMSA-N |
| XLogP | 5.90 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.54 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|