C12H17F — CID 154982226
(3Z,5Z,7R)-5-fluoro-6,7,8-trimethylnona-3,5-dien-1-yne (PubChem CID 154982226) has the molecular formula C12H17F and a molecular weight of 180.27 g/mol. Its IUPAC name is (3Z,5Z,7R)-5-fluoro-6,7,8-trimethylnona-3,5-dien-1-yne.
| Compound Name | (3Z,5Z,7R)-5-fluoro-6,7,8-trimethylnona-3,5-dien-1-yne |
|---|---|
| PubChem CID | 154982226 |
| Molecular Formula | C12H17F |
| Molecular Weight | 180.27 g/mol |
| Exact Mass | 180.13 |
| IUPAC Name | (3Z,5Z,7R)-5-fluoro-6,7,8-trimethylnona-3,5-dien-1-yne |
| SMILES | C#C/C=C\C(F)=C(/C)[C@H](C)C(C)C |
| InChI | InChI=1S/C12H17F/c1-6-7-8-12(13)11(5)10(4)9(2)3/h1,7-10H,2-5H3/b8-7-,12-11-/t10-/m1/s1 |
| InChIKey | OIRRDNCQRGOJDJ-RMNOIEMPSA-N |
| XLogP | 3.71 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.27 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|