C18H18F4N8O3 — CID 154982637
N-[[2-fluoro-5-(trifluoromethoxy)phenyl]methyl]-1-[4-(4-formamidotriazol-1-yl)butyl]triazole-4-carboxamide (PubChem CID 154982637) has the molecular formula C18H18F4N8O3 and a molecular weight of 470.39 g/mol. Its IUPAC name is N-[[2-fluoro-5-(trifluoromethoxy)phenyl]methyl]-1-[4-(4-formamidotriazol-1-yl)butyl]triazole-4-carboxamide.
| Compound Name | N-[[2-fluoro-5-(trifluoromethoxy)phenyl]methyl]-1-[4-(4-formamidotriazol-1-yl)butyl]triazole-4-carboxamide |
|---|---|
| PubChem CID | 154982637 |
| Molecular Formula | C18H18F4N8O3 |
| Molecular Weight | 470.39 g/mol |
| Exact Mass | 470.14 |
| IUPAC Name | N-[[2-fluoro-5-(trifluoromethoxy)phenyl]methyl]-1-[4-(4-formamidotriazol-1-yl)butyl]triazole-4-carboxamide |
| SMILES | O=CNc1cn(CCCCn2cc(C(=O)NCc3cc(OC(F)(F)F)ccc3F)nn2)nn1 |
| InChI | InChI=1S/C18H18F4N8O3/c19-14-4-3-13(33-18(20,21)22)7-12(14)8-23-17(32)15-9-29(27-25-15)5-1-2-6-30-10-16(24-11-31)26-28-30/h3-4,7,9-11H,1-2,5-6,8H2,(H,23,32)(H,24,31) |
| InChIKey | CAXCCCFMNOOSAK-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 128.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.39 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|