C11H16OS — CID 154983033
(3Z,5Z)-5-(3-sulfanylpropyl)octa-1,3,5,7-tetraen-2-ol (PubChem CID 154983033) has the molecular formula C11H16OS and a molecular weight of 196.31 g/mol. Its IUPAC name is (3Z,5Z)-5-(3-sulfanylpropyl)octa-1,3,5,7-tetraen-2-ol.
| Compound Name | (3Z,5Z)-5-(3-sulfanylpropyl)octa-1,3,5,7-tetraen-2-ol |
|---|---|
| PubChem CID | 154983033 |
| Molecular Formula | C11H16OS |
| Molecular Weight | 196.31 g/mol |
| Exact Mass | 196.09 |
| IUPAC Name | (3Z,5Z)-5-(3-sulfanylpropyl)octa-1,3,5,7-tetraen-2-ol |
| SMILES | C=C/C=C(\C=C/C(=C)O)CCCS |
| InChI | InChI=1S/C11H16OS/c1-3-5-11(6-4-9-13)8-7-10(2)12/h3,5,7-8,12-13H,1-2,4,6,9H2/b8-7-,11-5- |
| InChIKey | JQRHYRGUDODHQI-RNNYEWFJSA-N |
| XLogP | 3.44 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.31 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|