C30H57N3O5 — CID 154984082
2-(2,3-dihydroxypropoxy)-3,3,3-tris(2,3-dipropylaziridin-1-yl)propanoic acid (PubChem CID 154984082) has the molecular formula C30H57N3O5 and a molecular weight of 539.80 g/mol. Its IUPAC name is 2-(2,3-dihydroxypropoxy)-3,3,3-tris(2,3-dipropylaziridin-1-yl)propanoic acid.
| Compound Name | 2-(2,3-dihydroxypropoxy)-3,3,3-tris(2,3-dipropylaziridin-1-yl)propanoic acid |
|---|---|
| PubChem CID | 154984082 |
| Molecular Formula | C30H57N3O5 |
| Molecular Weight | 539.80 g/mol |
| Exact Mass | 539.43 |
| IUPAC Name | 2-(2,3-dihydroxypropoxy)-3,3,3-tris(2,3-dipropylaziridin-1-yl)propanoic acid |
| SMILES | CCCC1C(CCC)N1C(C(OCC(O)CO)C(=O)O)(N1C(CCC)C1CCC)N1C(CCC)C1CCC |
| InChI | InChI=1S/C30H57N3O5/c1-7-13-22-23(14-8-2)31(22)30(28(29(36)37)38-20-21(35)19-34,32-24(15-9-3)25(32)16-10-4)33-26(17-11-5)27(33)18-12-6/h21-28,34-35H,7-20H2,1-6H3,(H,36,37) |
| InChIKey | YFDCCHYPYFAICC-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.80 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|