C14H11Cl2FN6O2 — CID 154984366
(2S)-2-(cyanomethyl)-4-(2,7-dichloro-8-fluoropyrido[4,3-d]pyrimidin-4-yl)piperazine-1-carboxylic acid (PubChem CID 154984366) has the molecular formula C14H11Cl2FN6O2 and a molecular weight of 385.19 g/mol. Its IUPAC name is (2S)-2-(cyanomethyl)-4-(2,7-dichloro-8-fluoropyrido[4,3-d]pyrimidin-4-yl)piperazine-1-carboxylic acid.
| Compound Name | (2S)-2-(cyanomethyl)-4-(2,7-dichloro-8-fluoropyrido[4,3-d]pyrimidin-4-yl)piperazine-1-carboxylic acid |
|---|---|
| PubChem CID | 154984366 |
| Molecular Formula | C14H11Cl2FN6O2 |
| Molecular Weight | 385.19 g/mol |
| Exact Mass | 384.03 |
| IUPAC Name | (2S)-2-(cyanomethyl)-4-(2,7-dichloro-8-fluoropyrido[4,3-d]pyrimidin-4-yl)piperazine-1-carboxylic acid |
| SMILES | N#CC[C@H]1CN(c2nc(Cl)nc3c(F)c(Cl)ncc23)CCN1C(=O)O |
| InChI | InChI=1S/C14H11Cl2FN6O2/c15-11-9(17)10-8(5-19-11)12(21-13(16)20-10)22-3-4-23(14(24)25)7(6-22)1-2-18/h5,7H,1,3-4,6H2,(H,24,25)/t7-/m0/s1 |
| InChIKey | RPVQTFACADRJKI-ZETCQYMHSA-N |
| XLogP | 2.55 |
| TPSA | 106.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.19 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|