C30H44N6O6 — CID 154984522
3-[6-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethoxy]-3-pyridinyl]-9-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)nonanoic acid (PubChem CID 154984522) has the molecular formula C30H44N6O6 and a molecular weight of 584.72 g/mol. Its IUPAC name is 3-[6-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethoxy]-3-pyridinyl]-9-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)nonanoic acid.
| Compound Name | 3-[6-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethoxy]-3-pyridinyl]-9-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)nonanoic acid |
|---|---|
| PubChem CID | 154984522 |
| Molecular Formula | C30H44N6O6 |
| Molecular Weight | 584.72 g/mol |
| Exact Mass | 584.33 |
| IUPAC Name | 3-[6-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethoxy]-3-pyridinyl]-9-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)nonanoic acid |
| SMILES | [N-]=[N+]=NCCOCCOCCOCCOc1ccc(C(CCCCCCc2ccc3c(n2)NCCC3)CC(=O)O)cn1 |
| InChI | InChI=1S/C30H44N6O6/c31-36-34-14-15-39-16-17-40-18-19-41-20-21-42-28-12-10-26(23-33-28)25(22-29(37)38)6-3-1-2-4-8-27-11-9-24-7-5-13-32-30(24)35-27/h9-12,23,25H,1-8,13-22H2,(H,32,35)(H,37,38) |
| InChIKey | VSIZFNDBDHHUHW-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 160.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.72 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|