C21H17F2N7O3 — CID 154985016
1-[[3-[(1R,5R,6S)-3-[3-(difluoromethoxy)phenyl]-3-azatricyclo[3.1.0.02,6]hexan-1-yl]-1,2,4-oxadiazol-5-yl]methyl]-7-methylpurin-6-one (PubChem CID 154985016) has the molecular formula C21H17F2N7O3 and a molecular weight of 453.41 g/mol. Its IUPAC name is 1-[[3-[(1R,5R,6S)-3-[3-(difluoromethoxy)phenyl]-3-azatricyclo[3.1.0.02,6]hexan-1-yl]-1,2,4-oxadiazol-5-yl]methyl]-7-methylpurin-6-one.
| Compound Name | 1-[[3-[(1R,5R,6S)-3-[3-(difluoromethoxy)phenyl]-3-azatricyclo[3.1.0.02,6]hexan-1-yl]-1,2,4-oxadiazol-5-yl]methyl]-7-methylpurin-6-one |
|---|---|
| PubChem CID | 154985016 |
| Molecular Formula | C21H17F2N7O3 |
| Molecular Weight | 453.41 g/mol |
| Exact Mass | 453.14 |
| IUPAC Name | 1-[[3-[(1R,5R,6S)-3-[3-(difluoromethoxy)phenyl]-3-azatricyclo[3.1.0.02,6]hexan-1-yl]-1,2,4-oxadiazol-5-yl]methyl]-7-methylpurin-6-one |
| SMILES | Cn1cnc2ncn(Cc3nc([C@@]45C6[C@H]4[C@H]5CN6c4cccc(OC(F)F)c4)no3)c(=O)c21 |
| InChI | InChI=1S/C21H17F2N7O3/c1-28-8-24-17-15(28)18(31)29(9-25-17)7-13-26-19(27-33-13)21-12-6-30(16(21)14(12)21)10-3-2-4-11(5-10)32-20(22)23/h2-5,8-9,12,14,16,20H,6-7H2,1H3/t12-,14-,16?,21-/m1/s1 |
| InChIKey | GLIXILZZQMSQNR-LLRDTSMASA-N |
| XLogP | 1.55 |
| TPSA | 104.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.41 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |