C21H15ClN6O2 — CID 154985032
1-[[3-[(1R,5R,6R)-3-(4-chlorophenyl)-1-tricyclo[3.1.0.02,6]hex-2-enyl]-1,2,4-oxadiazol-5-yl]methyl]-7-methylpurin-6-one (PubChem CID 154985032) has the molecular formula C21H15ClN6O2 and a molecular weight of 418.84 g/mol. Its IUPAC name is 1-[[3-[(1R,5R,6R)-3-(4-chlorophenyl)-1-tricyclo[3.1.0.02,6]hex-2-enyl]-1,2,4-oxadiazol-5-yl]methyl]-7-methylpurin-6-one.
| Compound Name | 1-[[3-[(1R,5R,6R)-3-(4-chlorophenyl)-1-tricyclo[3.1.0.02,6]hex-2-enyl]-1,2,4-oxadiazol-5-yl]methyl]-7-methylpurin-6-one |
|---|---|
| PubChem CID | 154985032 |
| Molecular Formula | C21H15ClN6O2 |
| Molecular Weight | 418.84 g/mol |
| Exact Mass | 418.09 |
| IUPAC Name | 1-[[3-[(1R,5R,6R)-3-(4-chlorophenyl)-1-tricyclo[3.1.0.02,6]hex-2-enyl]-1,2,4-oxadiazol-5-yl]methyl]-7-methylpurin-6-one |
| SMILES | Cn1cnc2ncn(Cc3nc([C@]45C6=C(c7ccc(Cl)cc7)C[C@@H]4[C@H]65)no3)c(=O)c21 |
| InChI | InChI=1S/C21H15ClN6O2/c1-27-8-23-18-17(27)19(29)28(9-24-18)7-14-25-20(26-30-14)21-13-6-12(15(21)16(13)21)10-2-4-11(22)5-3-10/h2-5,8-9,13,16H,6-7H2,1H3/t13-,16-,21+/m1/s1 |
| InChIKey | FHTMZUIAKPJVNU-FQWGINHLSA-N |
| XLogP | 2.57 |
| TPSA | 91.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.84 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |