C22H27F2N7S — CID 154985780
1-(2,4-difluorophenyl)-5-[3-[(4-methyl-3-pyrazin-2-yl-1,5-dihydro-1,2,4-triazol-5-yl)sulfanyl]propyl]-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrole (PubChem CID 154985780) has the molecular formula C22H27F2N7S and a molecular weight of 459.57 g/mol. Its IUPAC name is 1-(2,4-difluorophenyl)-5-[3-[(4-methyl-3-pyrazin-2-yl-1,5-dihydro-1,2,4-triazol-5-yl)sulfanyl]propyl]-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrole.
| Compound Name | 1-(2,4-difluorophenyl)-5-[3-[(4-methyl-3-pyrazin-2-yl-1,5-dihydro-1,2,4-triazol-5-yl)sulfanyl]propyl]-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrole |
|---|---|
| PubChem CID | 154985780 |
| Molecular Formula | C22H27F2N7S |
| Molecular Weight | 459.57 g/mol |
| Exact Mass | 459.20 |
| IUPAC Name | 1-(2,4-difluorophenyl)-5-[3-[(4-methyl-3-pyrazin-2-yl-1,5-dihydro-1,2,4-triazol-5-yl)sulfanyl]propyl]-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrole |
| SMILES | CN1C(c2cnccn2)=NNC1SCCCN1CC2CCN(c3ccc(F)cc3F)C2C1 |
| InChI | InChI=1S/C22H27F2N7S/c1-29-21(18-12-25-6-7-26-18)27-28-22(29)32-10-2-8-30-13-15-5-9-31(20(15)14-30)19-4-3-16(23)11-17(19)24/h3-4,6-7,11-12,15,20,22,28H,2,5,8-10,13-14H2,1H3 |
| InChIKey | USPOVOCZLWIZDH-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 59.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.57 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|