C23H45N3O — CID 154986329
N'-[3-(dimethylamino)propyl]-N,N-dimethyl-N'-[2-[(2Z)-2-methyl-6-methylideneocta-2,7-dienoxy]propyl]propane-1,3-diamine (PubChem CID 154986329) has the molecular formula C23H45N3O and a molecular weight of 379.63 g/mol. Its IUPAC name is N'-[3-(dimethylamino)propyl]-N,N-dimethyl-N'-[2-[(2Z)-2-methyl-6-methylideneocta-2,7-dienoxy]propyl]propane-1,3-diamine.
| Compound Name | N'-[3-(dimethylamino)propyl]-N,N-dimethyl-N'-[2-[(2Z)-2-methyl-6-methylideneocta-2,7-dienoxy]propyl]propane-1,3-diamine |
|---|---|
| PubChem CID | 154986329 |
| Molecular Formula | C23H45N3O |
| Molecular Weight | 379.63 g/mol |
| Exact Mass | 379.36 |
| IUPAC Name | N'-[3-(dimethylamino)propyl]-N,N-dimethyl-N'-[2-[(2Z)-2-methyl-6-methylideneocta-2,7-dienoxy]propyl]propane-1,3-diamine |
| SMILES | C=CC(=C)CC/C=C(/C)COC(C)CN(CCCN(C)C)CCCN(C)C |
| InChI | InChI=1S/C23H45N3O/c1-9-21(2)13-10-14-22(3)20-27-23(4)19-26(17-11-15-24(5)6)18-12-16-25(7)8/h9,14,23H,1-2,10-13,15-20H2,3-8H3/b22-14- |
| InChIKey | ZIGBGRLTXYGETE-HMAPJEAMSA-N |
| XLogP | 4.07 |
| TPSA | 18.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.63 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|