About 4-(dimethylamino)cyclohepta-1,3-diene-1-carbaldehyde
4-(dimethylamino)cyclohepta-1,3-diene-1-carbaldehyde (PubChem CID 154986715) has the molecular formula C10H15NO
and a molecular weight of 165.24 g/mol. Its IUPAC name is 4-(dimethylamino)cyclohepta-1,3-diene-1-carbaldehyde.
Molecular Properties
| Compound Name | 4-(dimethylamino)cyclohepta-1,3-diene-1-carbaldehyde |
| PubChem CID | 154986715 |
| Molecular Formula | C10H15NO |
| Molecular Weight | 165.24 g/mol |
| Exact Mass | 165.12 |
| IUPAC Name | 4-(dimethylamino)cyclohepta-1,3-diene-1-carbaldehyde |
| SMILES | CN(C)C1=CC=C(C=O)CCC1 |
| InChI | InChI=1S/C10H15NO/c1-11(2)10-5-3-4-9(8-12)6-7-10/h6-8H,3-5H2,1-2H3 |
| InChIKey | IEHQQQZBRKGPRZ-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.24 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 4-(dimethylamino)cyclohepta-1,3-diene-1-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(dimethylamino)cyclohepta-1,3-diene-1-carbaldehyde?
The IUPAC name of 4-(dimethylamino)cyclohepta-1,3-diene-1-carbaldehyde (CID 154986715) is 4-(dimethylamino)cyclohepta-1,3-diene-1-carbaldehyde.
What is the SMILES notation for 4-(dimethylamino)cyclohepta-1,3-diene-1-carbaldehyde?
The canonical SMILES for 4-(dimethylamino)cyclohepta-1,3-diene-1-carbaldehyde is CN(C)C1=CC=C(C=O)CCC1.
What is the InChIKey of 4-(dimethylamino)cyclohepta-1,3-diene-1-carbaldehyde?
The InChIKey is IEHQQQZBRKGPRZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15NO/c1-11(2)10-5-3-4-9(8-12)6-7-10/h6-8H,3-5H2,1-2H3.
What are the key properties of 4-(dimethylamino)cyclohepta-1,3-diene-1-carbaldehyde?
4-(dimethylamino)cyclohepta-1,3-diene-1-carbaldehyde has a molecular weight of 165.24 g/mol, XLogP of 1.74, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(dimethylamino)cyclohepta-1,3-diene-1-carbaldehyde is sourced from PubChem (CID 154986715), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).