About tert-butyl (4S)-4-(heptylsulfanylmethyl)-2,2-dimethyl-1,3-oxazolidine-3-carboxylate
tert-butyl (4S)-4-(heptylsulfanylmethyl)-2,2-dimethyl-1,3-oxazolidine-3-carboxylate (PubChem CID 154986920) has the molecular formula C18H35NO3S
and a molecular weight of 345.55 g/mol. Its IUPAC name is tert-butyl (4S)-4-(heptylsulfanylmethyl)-2,2-dimethyl-1,3-oxazolidine-3-carboxylate.
Molecular Properties
| Compound Name | tert-butyl (4S)-4-(heptylsulfanylmethyl)-2,2-dimethyl-1,3-oxazolidine-3-carboxylate |
| PubChem CID | 154986920 |
| Molecular Formula | C18H35NO3S |
| Molecular Weight | 345.55 g/mol |
| Exact Mass | 345.23 |
| IUPAC Name | tert-butyl (4S)-4-(heptylsulfanylmethyl)-2,2-dimethyl-1,3-oxazolidine-3-carboxylate |
| SMILES | CCCCCCCSC[C@@H]1COC(C)(C)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H35NO3S/c1-7-8-9-10-11-12-23-14-15-13-21-18(5,6)19(15)16(20)22-17(2,3)4/h15H,7-14H2,1-6H3/t15-/m0/s1 |
| InChIKey | YUWRXSYKKBAGSK-HNNXBMFYSA-N |
| XLogP | 5.06 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 345.55 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl (4S)-4-(heptylsulfanylmethyl)-2,2-dimethyl-1,3-oxazolidine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl (4S)-4-(heptylsulfanylmethyl)-2,2-dimethyl-1,3-oxazolidine-3-carboxylate?
The IUPAC name of tert-butyl (4S)-4-(heptylsulfanylmethyl)-2,2-dimethyl-1,3-oxazolidine-3-carboxylate (CID 154986920) is tert-butyl (4S)-4-(heptylsulfanylmethyl)-2,2-dimethyl-1,3-oxazolidine-3-carboxylate.
What is the SMILES notation for tert-butyl (4S)-4-(heptylsulfanylmethyl)-2,2-dimethyl-1,3-oxazolidine-3-carboxylate?
The canonical SMILES for tert-butyl (4S)-4-(heptylsulfanylmethyl)-2,2-dimethyl-1,3-oxazolidine-3-carboxylate is CCCCCCCSC[C@@H]1COC(C)(C)N1C(=O)OC(C)(C)C.
What is the InChIKey of tert-butyl (4S)-4-(heptylsulfanylmethyl)-2,2-dimethyl-1,3-oxazolidine-3-carboxylate?
The InChIKey is YUWRXSYKKBAGSK-HNNXBMFYSA-N. The full InChI is InChI=1S/C18H35NO3S/c1-7-8-9-10-11-12-23-14-15-13-21-18(5,6)19(15)16(20)22-17(2,3)4/h15H,7-14H2,1-6H3/t15-/m0/s1.
What are the key properties of tert-butyl (4S)-4-(heptylsulfanylmethyl)-2,2-dimethyl-1,3-oxazolidine-3-carboxylate?
tert-butyl (4S)-4-(heptylsulfanylmethyl)-2,2-dimethyl-1,3-oxazolidine-3-carboxylate has a molecular weight of 345.55 g/mol, XLogP of 5.06, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl (4S)-4-(heptylsulfanylmethyl)-2,2-dimethyl-1,3-oxazolidine-3-carboxylate is sourced from PubChem (CID 154986920), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).