C29H26N2S — CID 154987007
N-buta-1,3-dien-2-yl-4-[5-ethenyl-6-(4-phenylsulfanylcyclohexa-1,3-dien-1-yl)-2-pyridinyl]aniline (PubChem CID 154987007) has the molecular formula C29H26N2S and a molecular weight of 434.61 g/mol. Its IUPAC name is N-buta-1,3-dien-2-yl-4-[5-ethenyl-6-(4-phenylsulfanylcyclohexa-1,3-dien-1-yl)-2-pyridinyl]aniline.
| Compound Name | N-buta-1,3-dien-2-yl-4-[5-ethenyl-6-(4-phenylsulfanylcyclohexa-1,3-dien-1-yl)-2-pyridinyl]aniline |
|---|---|
| PubChem CID | 154987007 |
| Molecular Formula | C29H26N2S |
| Molecular Weight | 434.61 g/mol |
| Exact Mass | 434.18 |
| IUPAC Name | N-buta-1,3-dien-2-yl-4-[5-ethenyl-6-(4-phenylsulfanylcyclohexa-1,3-dien-1-yl)-2-pyridinyl]aniline |
| SMILES | C=CC(=C)Nc1ccc(-c2ccc(C=C)c(C3=CC=C(Sc4ccccc4)CC3)n2)cc1 |
| InChI | InChI=1S/C29H26N2S/c1-4-21(3)30-25-16-11-23(12-17-25)28-20-15-22(5-2)29(31-28)24-13-18-27(19-14-24)32-26-9-7-6-8-10-26/h4-13,15-18,20,30H,1-3,14,19H2 |
| InChIKey | NEPOIJNRMOWKNU-UHFFFAOYSA-N |
| XLogP | 8.36 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.61 |
| LogP ≤ 5 | 8.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|