About 2,7-dimethyl-4,6-bis(trifluoromethyl)cyclohepten-1-amine
2,7-dimethyl-4,6-bis(trifluoromethyl)cyclohepten-1-amine (PubChem CID 154987114) has the molecular formula C11H15F6N
and a molecular weight of 275.24 g/mol. Its IUPAC name is 2,7-dimethyl-4,6-bis(trifluoromethyl)cyclohepten-1-amine.
Molecular Properties
| Compound Name | 2,7-dimethyl-4,6-bis(trifluoromethyl)cyclohepten-1-amine |
| PubChem CID | 154987114 |
| Molecular Formula | C11H15F6N |
| Molecular Weight | 275.24 g/mol |
| Exact Mass | 275.11 |
| IUPAC Name | 2,7-dimethyl-4,6-bis(trifluoromethyl)cyclohepten-1-amine |
| SMILES | CC1=C(N)C(C)C(C(F)(F)F)CC(C(F)(F)F)C1 |
| InChI | InChI=1S/C11H15F6N/c1-5-3-7(10(12,13)14)4-8(11(15,16)17)6(2)9(5)18/h6-8H,3-4,18H2,1-2H3 |
| InChIKey | MVOBZCZPJDRQFQ-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.24 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2,7-dimethyl-4,6-bis(trifluoromethyl)cyclohepten-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,7-dimethyl-4,6-bis(trifluoromethyl)cyclohepten-1-amine?
The IUPAC name of 2,7-dimethyl-4,6-bis(trifluoromethyl)cyclohepten-1-amine (CID 154987114) is 2,7-dimethyl-4,6-bis(trifluoromethyl)cyclohepten-1-amine.
What is the SMILES notation for 2,7-dimethyl-4,6-bis(trifluoromethyl)cyclohepten-1-amine?
The canonical SMILES for 2,7-dimethyl-4,6-bis(trifluoromethyl)cyclohepten-1-amine is CC1=C(N)C(C)C(C(F)(F)F)CC(C(F)(F)F)C1.
What is the InChIKey of 2,7-dimethyl-4,6-bis(trifluoromethyl)cyclohepten-1-amine?
The InChIKey is MVOBZCZPJDRQFQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15F6N/c1-5-3-7(10(12,13)14)4-8(11(15,16)17)6(2)9(5)18/h6-8H,3-4,18H2,1-2H3.
What are the key properties of 2,7-dimethyl-4,6-bis(trifluoromethyl)cyclohepten-1-amine?
2,7-dimethyl-4,6-bis(trifluoromethyl)cyclohepten-1-amine has a molecular weight of 275.24 g/mol, XLogP of 4.01, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,7-dimethyl-4,6-bis(trifluoromethyl)cyclohepten-1-amine is sourced from PubChem (CID 154987114), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).