About 6-acetyl-3-methylidene-6-azatetracyclo[8.5.0.02,4.02,7]pentadec-7-en-9-one
6-acetyl-3-methylidene-6-azatetracyclo[8.5.0.02,4.02,7]pentadec-7-en-9-one (PubChem CID 154987210) has the molecular formula C17H21NO2
and a molecular weight of 271.36 g/mol. Its IUPAC name is 6-acetyl-3-methylidene-6-azatetracyclo[8.5.0.02,4.02,7]pentadec-7-en-9-one.
Molecular Properties
| Compound Name | 6-acetyl-3-methylidene-6-azatetracyclo[8.5.0.02,4.02,7]pentadec-7-en-9-one |
| PubChem CID | 154987210 |
| Molecular Formula | C17H21NO2 |
| Molecular Weight | 271.36 g/mol |
| Exact Mass | 271.16 |
| IUPAC Name | 6-acetyl-3-methylidene-6-azatetracyclo[8.5.0.02,4.02,7]pentadec-7-en-9-one |
| SMILES | C=C1C2CN(C(C)=O)C3=CC(=O)C4CCCCCC4C132 |
| InChI | InChI=1S/C17H21NO2/c1-10-14-9-18(11(2)19)16-8-15(20)12-6-4-3-5-7-13(12)17(10,14)16/h8,12-14H,1,3-7,9H2,2H3 |
| InChIKey | LEHYIMPRTKWOOK-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.36 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 6-acetyl-3-methylidene-6-azatetracyclo[8.5.0.02,4.02,7]pentadec-7-en-9-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-acetyl-3-methylidene-6-azatetracyclo[8.5.0.02,4.02,7]pentadec-7-en-9-one?
The IUPAC name of 6-acetyl-3-methylidene-6-azatetracyclo[8.5.0.02,4.02,7]pentadec-7-en-9-one (CID 154987210) is 6-acetyl-3-methylidene-6-azatetracyclo[8.5.0.02,4.02,7]pentadec-7-en-9-one.
What is the SMILES notation for 6-acetyl-3-methylidene-6-azatetracyclo[8.5.0.02,4.02,7]pentadec-7-en-9-one?
The canonical SMILES for 6-acetyl-3-methylidene-6-azatetracyclo[8.5.0.02,4.02,7]pentadec-7-en-9-one is C=C1C2CN(C(C)=O)C3=CC(=O)C4CCCCCC4C132.
What is the InChIKey of 6-acetyl-3-methylidene-6-azatetracyclo[8.5.0.02,4.02,7]pentadec-7-en-9-one?
The InChIKey is LEHYIMPRTKWOOK-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H21NO2/c1-10-14-9-18(11(2)19)16-8-15(20)12-6-4-3-5-7-13(12)17(10,14)16/h8,12-14H,1,3-7,9H2,2H3.
What are the key properties of 6-acetyl-3-methylidene-6-azatetracyclo[8.5.0.02,4.02,7]pentadec-7-en-9-one?
6-acetyl-3-methylidene-6-azatetracyclo[8.5.0.02,4.02,7]pentadec-7-en-9-one has a molecular weight of 271.36 g/mol, XLogP of 2.68, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-acetyl-3-methylidene-6-azatetracyclo[8.5.0.02,4.02,7]pentadec-7-en-9-one is sourced from PubChem (CID 154987210), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).