C19H31NO3 — CID 15498755
[(2R,3R,6R)-4-methylidene-2,6-bis[(E)-prop-1-enyl]oxan-3-yl] N,N-di(propan-2-yl)carbamate (PubChem CID 15498755) has the molecular formula C19H31NO3 and a molecular weight of 321.46 g/mol. Its IUPAC name is [(2R,3R,6R)-4-methylidene-2,6-bis[(E)-prop-1-enyl]oxan-3-yl] N,N-di(propan-2-yl)carbamate.
| Compound Name | [(2R,3R,6R)-4-methylidene-2,6-bis[(E)-prop-1-enyl]oxan-3-yl] N,N-di(propan-2-yl)carbamate |
|---|---|
| PubChem CID | 15498755 |
| Molecular Formula | C19H31NO3 |
| Molecular Weight | 321.46 g/mol |
| Exact Mass | 321.23 |
| IUPAC Name | [(2R,3R,6R)-4-methylidene-2,6-bis[(E)-prop-1-enyl]oxan-3-yl] N,N-di(propan-2-yl)carbamate |
| SMILES | C=C1C[C@H](/C=C/C)O[C@H](/C=C/C)[C@@H]1OC(=O)N(C(C)C)C(C)C |
| InChI | InChI=1S/C19H31NO3/c1-8-10-16-12-15(7)18(17(22-16)11-9-2)23-19(21)20(13(3)4)14(5)6/h8-11,13-14,16-18H,7,12H2,1-6H3/b10-8+,11-9+/t16-,17+,18+/m0/s1 |
| InChIKey | FDWNQZVZEXUCPC-AKCVFNNCSA-N |
| XLogP | 4.48 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.46 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|