C24H24Cl2FN3O3 — CID 154987626
N-[2-[6-(2,6-dichloro-3,5-dimethoxyphenyl)-4,5,6,7-tetrahydro-1H-indazol-3-yl]-5-fluorocyclohexa-1,5-dien-1-yl]prop-2-enamide (PubChem CID 154987626) has the molecular formula C24H24Cl2FN3O3 and a molecular weight of 492.38 g/mol. Its IUPAC name is N-[2-[6-(2,6-dichloro-3,5-dimethoxyphenyl)-4,5,6,7-tetrahydro-1H-indazol-3-yl]-5-fluorocyclohexa-1,5-dien-1-yl]prop-2-enamide.
| Compound Name | N-[2-[6-(2,6-dichloro-3,5-dimethoxyphenyl)-4,5,6,7-tetrahydro-1H-indazol-3-yl]-5-fluorocyclohexa-1,5-dien-1-yl]prop-2-enamide |
|---|---|
| PubChem CID | 154987626 |
| Molecular Formula | C24H24Cl2FN3O3 |
| Molecular Weight | 492.38 g/mol |
| Exact Mass | 491.12 |
| IUPAC Name | N-[2-[6-(2,6-dichloro-3,5-dimethoxyphenyl)-4,5,6,7-tetrahydro-1H-indazol-3-yl]-5-fluorocyclohexa-1,5-dien-1-yl]prop-2-enamide |
| SMILES | C=CC(=O)NC1=C(c2n[nH]c3c2CCC(c2c(Cl)c(OC)cc(OC)c2Cl)C3)CCC(F)=C1 |
| InChI | InChI=1S/C24H24Cl2FN3O3/c1-4-20(31)28-16-10-13(27)6-8-14(16)24-15-7-5-12(9-17(15)29-30-24)21-22(25)18(32-2)11-19(33-3)23(21)26/h4,10-12H,1,5-9H2,2-3H3,(H,28,31)(H,29,30) |
| InChIKey | DJWKIRCBCSIJGM-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 76.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.38 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|