C23H31FO — CID 154987655
2-fluoro-5-[(5-octylcyclohepta-1,4,6-trien-1-yl)oxymethyl]cyclohepta-1,3,5-triene (PubChem CID 154987655) has the molecular formula C23H31FO and a molecular weight of 342.50 g/mol. Its IUPAC name is 2-fluoro-5-[(5-octylcyclohepta-1,4,6-trien-1-yl)oxymethyl]cyclohepta-1,3,5-triene.
| Compound Name | 2-fluoro-5-[(5-octylcyclohepta-1,4,6-trien-1-yl)oxymethyl]cyclohepta-1,3,5-triene |
|---|---|
| PubChem CID | 154987655 |
| Molecular Formula | C23H31FO |
| Molecular Weight | 342.50 g/mol |
| Exact Mass | 342.24 |
| IUPAC Name | 2-fluoro-5-[(5-octylcyclohepta-1,4,6-trien-1-yl)oxymethyl]cyclohepta-1,3,5-triene |
| SMILES | CCCCCCCCC1=CCC=C(OCC2=CCC=C(F)C=C2)C=C1 |
| InChI | InChI=1S/C23H31FO/c1-2-3-4-5-6-7-10-20-11-9-14-23(18-16-20)25-19-21-12-8-13-22(24)17-15-21/h11-18H,2-10,19H2,1H3 |
| InChIKey | HXEXUDWTZYXMKY-UHFFFAOYSA-N |
| XLogP | 7.26 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.50 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|