C29H32F5N3O — CID 154987668
(1S,3R)-1-[2,6-difluoro-4-[1-(3-fluoropropyl)azetidin-3-yl]oxyphenyl]-3-ethenyl-7-fluoro-2-(2-fluoro-2-methylpropyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole (PubChem CID 154987668) has the molecular formula C29H32F5N3O and a molecular weight of 533.59 g/mol. Its IUPAC name is (1S,3R)-1-[2,6-difluoro-4-[1-(3-fluoropropyl)azetidin-3-yl]oxyphenyl]-3-ethenyl-7-fluoro-2-(2-fluoro-2-methylpropyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole.
| Compound Name | (1S,3R)-1-[2,6-difluoro-4-[1-(3-fluoropropyl)azetidin-3-yl]oxyphenyl]-3-ethenyl-7-fluoro-2-(2-fluoro-2-methylpropyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole |
|---|---|
| PubChem CID | 154987668 |
| Molecular Formula | C29H32F5N3O |
| Molecular Weight | 533.59 g/mol |
| Exact Mass | 533.25 |
| IUPAC Name | (1S,3R)-1-[2,6-difluoro-4-[1-(3-fluoropropyl)azetidin-3-yl]oxyphenyl]-3-ethenyl-7-fluoro-2-(2-fluoro-2-methylpropyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole |
| SMILES | C=C[C@H]1Cc2c([nH]c3cc(F)ccc23)[C@H](c2c(F)cc(OC3CN(CCCF)C3)cc2F)N1CC(C)(C)F |
| InChI | InChI=1S/C29H32F5N3O/c1-4-18-11-22-21-7-6-17(31)10-25(21)35-27(22)28(37(18)16-29(2,3)34)26-23(32)12-19(13-24(26)33)38-20-14-36(15-20)9-5-8-30/h4,6-7,10,12-13,18,20,28,35H,1,5,8-9,11,14-16H2,2-3H3/t18-,28-/m0/s1 |
| InChIKey | BHCHHURWFDYTBX-JMQGSBJISA-N |
| XLogP | 6.26 |
| TPSA | 31.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.59 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|