C17H25FN2 — CID 154987694
(2E,5R)-6-(2-fluoro-2-methylpropyl)-5-methyl-2-[(2Z)-penta-2,4-dienylidene]-3,4,5,7-tetrahydro-1H-pyrrolo[2,3-c]pyridine (PubChem CID 154987694) has the molecular formula C17H25FN2 and a molecular weight of 276.40 g/mol. Its IUPAC name is (2E,5R)-6-(2-fluoro-2-methylpropyl)-5-methyl-2-[(2Z)-penta-2,4-dienylidene]-3,4,5,7-tetrahydro-1H-pyrrolo[2,3-c]pyridine.
| Compound Name | (2E,5R)-6-(2-fluoro-2-methylpropyl)-5-methyl-2-[(2Z)-penta-2,4-dienylidene]-3,4,5,7-tetrahydro-1H-pyrrolo[2,3-c]pyridine |
|---|---|
| PubChem CID | 154987694 |
| Molecular Formula | C17H25FN2 |
| Molecular Weight | 276.40 g/mol |
| Exact Mass | 276.20 |
| IUPAC Name | (2E,5R)-6-(2-fluoro-2-methylpropyl)-5-methyl-2-[(2Z)-penta-2,4-dienylidene]-3,4,5,7-tetrahydro-1H-pyrrolo[2,3-c]pyridine |
| SMILES | C=C/C=C\C=C1/CC2=C(CN(CC(C)(C)F)[C@H](C)C2)N1 |
| InChI | InChI=1S/C17H25FN2/c1-5-6-7-8-15-10-14-9-13(2)20(11-16(14)19-15)12-17(3,4)18/h5-8,13,19H,1,9-12H2,2-4H3/b7-6-,15-8+/t13-/m1/s1 |
| InChIKey | BHFWSKZCBQXCDY-ABAAVDHGSA-N |
| XLogP | 3.70 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.40 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|