C16H23FN2 — CID 154987733
(3R)-2-(2-fluoro-2-methylpropyl)-3-methyl-1,3,4,6,7,9-hexahydropyrido[3,4-b]indole (PubChem CID 154987733) has the molecular formula C16H23FN2 and a molecular weight of 262.37 g/mol. Its IUPAC name is (3R)-2-(2-fluoro-2-methylpropyl)-3-methyl-1,3,4,6,7,9-hexahydropyrido[3,4-b]indole.
| Compound Name | (3R)-2-(2-fluoro-2-methylpropyl)-3-methyl-1,3,4,6,7,9-hexahydropyrido[3,4-b]indole |
|---|---|
| PubChem CID | 154987733 |
| Molecular Formula | C16H23FN2 |
| Molecular Weight | 262.37 g/mol |
| Exact Mass | 262.18 |
| IUPAC Name | (3R)-2-(2-fluoro-2-methylpropyl)-3-methyl-1,3,4,6,7,9-hexahydropyrido[3,4-b]indole |
| SMILES | C[C@@H]1Cc2c([nH]c3c2=CCCC=3)CN1CC(C)(C)F |
| InChI | InChI=1S/C16H23FN2/c1-11-8-13-12-6-4-5-7-14(12)18-15(13)9-19(11)10-16(2,3)17/h6-7,11,18H,4-5,8-10H2,1-3H3/t11-/m1/s1 |
| InChIKey | MEMVUIOBVYPJFB-LLVKDONJSA-N |
| XLogP | 1.86 |
| TPSA | 19.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.37 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |