About 2-[6-[[(1R,5S)-3-bicyclo[3.2.1]octanyl]oxy]pyridazin-3-yl]-5-(2H-triazol-4-yl)phenol
2-[6-[[(1R,5S)-3-bicyclo[3.2.1]octanyl]oxy]pyridazin-3-yl]-5-(2H-triazol-4-yl)phenol (PubChem CID 154988058) has the molecular formula C20H21N5O2
and a molecular weight of 363.42 g/mol. Its IUPAC name is 2-[6-[[(1R,5S)-3-bicyclo[3.2.1]octanyl]oxy]pyridazin-3-yl]-5-(2H-triazol-4-yl)phenol.
Molecular Properties
| Compound Name | 2-[6-[[(1R,5S)-3-bicyclo[3.2.1]octanyl]oxy]pyridazin-3-yl]-5-(2H-triazol-4-yl)phenol |
| PubChem CID | 154988058 |
| Molecular Formula | C20H21N5O2 |
| Molecular Weight | 363.42 g/mol |
| Exact Mass | 363.17 |
| IUPAC Name | 2-[6-[[(1R,5S)-3-bicyclo[3.2.1]octanyl]oxy]pyridazin-3-yl]-5-(2H-triazol-4-yl)phenol |
| SMILES | Oc1cc(-c2cn[nH]n2)ccc1-c1ccc(OC2C[C@H]3CC[C@@H](C2)C3)nn1 |
| InChI | InChI=1S/C20H21N5O2/c26-19-10-14(18-11-21-25-23-18)3-4-16(19)17-5-6-20(24-22-17)27-15-8-12-1-2-13(7-12)9-15/h3-6,10-13,15,26H,1-2,7-9H2,(H,21,23,25)/t12-,13+,15? |
| InChIKey | PJOAGHIIMWGRIR-NNQSOWQGSA-N |
| XLogP | 3.59 |
| TPSA | 96.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 363.42 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-[6-[[(1R,5S)-3-bicyclo[3.2.1]octanyl]oxy]pyridazin-3-yl]-5-(2H-triazol-4-yl)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[6-[[(1R,5S)-3-bicyclo[3.2.1]octanyl]oxy]pyridazin-3-yl]-5-(2H-triazol-4-yl)phenol?
The IUPAC name of 2-[6-[[(1R,5S)-3-bicyclo[3.2.1]octanyl]oxy]pyridazin-3-yl]-5-(2H-triazol-4-yl)phenol (CID 154988058) is 2-[6-[[(1R,5S)-3-bicyclo[3.2.1]octanyl]oxy]pyridazin-3-yl]-5-(2H-triazol-4-yl)phenol.
What is the SMILES notation for 2-[6-[[(1R,5S)-3-bicyclo[3.2.1]octanyl]oxy]pyridazin-3-yl]-5-(2H-triazol-4-yl)phenol?
The canonical SMILES for 2-[6-[[(1R,5S)-3-bicyclo[3.2.1]octanyl]oxy]pyridazin-3-yl]-5-(2H-triazol-4-yl)phenol is Oc1cc(-c2cn[nH]n2)ccc1-c1ccc(OC2C[C@H]3CC[C@@H](C2)C3)nn1.
What is the InChIKey of 2-[6-[[(1R,5S)-3-bicyclo[3.2.1]octanyl]oxy]pyridazin-3-yl]-5-(2H-triazol-4-yl)phenol?
The InChIKey is PJOAGHIIMWGRIR-NNQSOWQGSA-N. The full InChI is InChI=1S/C20H21N5O2/c26-19-10-14(18-11-21-25-23-18)3-4-16(19)17-5-6-20(24-22-17)27-15-8-12-1-2-13(7-12)9-15/h3-6,10-13,15,26H,1-2,7-9H2,(H,21,23,25)/t12-,13+,15?.
What are the key properties of 2-[6-[[(1R,5S)-3-bicyclo[3.2.1]octanyl]oxy]pyridazin-3-yl]-5-(2H-triazol-4-yl)phenol?
2-[6-[[(1R,5S)-3-bicyclo[3.2.1]octanyl]oxy]pyridazin-3-yl]-5-(2H-triazol-4-yl)phenol has a molecular weight of 363.42 g/mol, XLogP of 3.59, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[6-[[(1R,5S)-3-bicyclo[3.2.1]octanyl]oxy]pyridazin-3-yl]-5-(2H-triazol-4-yl)phenol is sourced from PubChem (CID 154988058), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).