C64H47NS — CID 154988203
2-[3-[4-[1-[(1Z)-buta-1,3-dienyl]-2,3,3-trimethylinden-5-yl]dibenzothiophen-2-yl]-5-(4-phenylphenyl)phenyl]-9-phenylcarbazole (PubChem CID 154988203) has the molecular formula C64H47NS and a molecular weight of 862.15 g/mol. Its IUPAC name is 2-[3-[4-[1-[(1Z)-buta-1,3-dienyl]-2,3,3-trimethylinden-5-yl]dibenzothiophen-2-yl]-5-(4-phenylphenyl)phenyl]-9-phenylcarbazole.
| Compound Name | 2-[3-[4-[1-[(1Z)-buta-1,3-dienyl]-2,3,3-trimethylinden-5-yl]dibenzothiophen-2-yl]-5-(4-phenylphenyl)phenyl]-9-phenylcarbazole |
|---|---|
| PubChem CID | 154988203 |
| Molecular Formula | C64H47NS |
| Molecular Weight | 862.15 g/mol |
| Exact Mass | 861.34 |
| IUPAC Name | 2-[3-[4-[1-[(1Z)-buta-1,3-dienyl]-2,3,3-trimethylinden-5-yl]dibenzothiophen-2-yl]-5-(4-phenylphenyl)phenyl]-9-phenylcarbazole |
| SMILES | C=C/C=C\C1=C(C)C(C)(C)c2cc(-c3cc(-c4cc(-c5ccc(-c6ccccc6)cc5)cc(-c5ccc6c7ccccc7n(-c7ccccc7)c6c5)c4)cc4c3sc3ccccc34)ccc21 |
| InChI | InChI=1S/C64H47NS/c1-5-6-21-52-41(2)64(3,4)59-39-46(31-32-53(52)59)57-37-50(38-58-56-23-14-16-25-62(56)66-63(57)58)49-35-47(44-28-26-43(27-29-44)42-17-9-7-10-18-42)34-48(36-49)45-30-33-55-54-22-13-15-24-60(54)65(61(55)40-45)51-19-11-8-12-20-51/h5-40H,1H2,2-4H3/b21-6- |
| InChIKey | KZCGSPKHNXMZBN-MPUCSWFWSA-N |
| XLogP | 18.29 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 862.15 |
| LogP ≤ 5 | 18.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|