About 2-N-[(1R)-1-[dimethyl(sulfanyl)-λ4-sulfanyl]propyl]-5-(trifluoromethyl)pyrimidine-2,4-diamine
2-N-[(1R)-1-[dimethyl(sulfanyl)-λ4-sulfanyl]propyl]-5-(trifluoromethyl)pyrimidine-2,4-diamine (PubChem CID 154988494) has the molecular formula C10H17F3N4S2
and a molecular weight of 314.40 g/mol. Its IUPAC name is 2-N-[(1R)-1-[dimethyl(sulfanyl)-λ4-sulfanyl]propyl]-5-(trifluoromethyl)pyrimidine-2,4-diamine.
Molecular Properties
| Compound Name | 2-N-[(1R)-1-[dimethyl(sulfanyl)-λ4-sulfanyl]propyl]-5-(trifluoromethyl)pyrimidine-2,4-diamine |
| PubChem CID | 154988494 |
| Molecular Formula | C10H17F3N4S2 |
| Molecular Weight | 314.40 g/mol |
| Exact Mass | 314.08 |
| IUPAC Name | 2-N-[(1R)-1-[dimethyl(sulfanyl)-λ4-sulfanyl]propyl]-5-(trifluoromethyl)pyrimidine-2,4-diamine |
| SMILES | CC[C@H](Nc1ncc(C(F)(F)F)c(N)n1)S(C)(C)S |
| InChI | InChI=1S/C10H17F3N4S2/c1-4-7(19(2,3)18)16-9-15-5-6(8(14)17-9)10(11,12)13/h5,7,18H,4H2,1-3H3,(H3,14,15,16,17)/t7-/m1/s1 |
| InChIKey | BELYLPJFJKQVMX-SSDOTTSWSA-N |
| XLogP | 3.13 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.40 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 2-N-[(1R)-1-[dimethyl(sulfanyl)-λ4-sulfanyl]propyl]-5-(trifluoromethyl)pyrimidine-2,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-N-[(1R)-1-[dimethyl(sulfanyl)-λ4-sulfanyl]propyl]-5-(trifluoromethyl)pyrimidine-2,4-diamine?
The IUPAC name of 2-N-[(1R)-1-[dimethyl(sulfanyl)-λ4-sulfanyl]propyl]-5-(trifluoromethyl)pyrimidine-2,4-diamine (CID 154988494) is 2-N-[(1R)-1-[dimethyl(sulfanyl)-λ4-sulfanyl]propyl]-5-(trifluoromethyl)pyrimidine-2,4-diamine.
What is the SMILES notation for 2-N-[(1R)-1-[dimethyl(sulfanyl)-λ4-sulfanyl]propyl]-5-(trifluoromethyl)pyrimidine-2,4-diamine?
The canonical SMILES for 2-N-[(1R)-1-[dimethyl(sulfanyl)-λ4-sulfanyl]propyl]-5-(trifluoromethyl)pyrimidine-2,4-diamine is CC[C@H](Nc1ncc(C(F)(F)F)c(N)n1)S(C)(C)S.
What is the InChIKey of 2-N-[(1R)-1-[dimethyl(sulfanyl)-λ4-sulfanyl]propyl]-5-(trifluoromethyl)pyrimidine-2,4-diamine?
The InChIKey is BELYLPJFJKQVMX-SSDOTTSWSA-N. The full InChI is InChI=1S/C10H17F3N4S2/c1-4-7(19(2,3)18)16-9-15-5-6(8(14)17-9)10(11,12)13/h5,7,18H,4H2,1-3H3,(H3,14,15,16,17)/t7-/m1/s1.
What are the key properties of 2-N-[(1R)-1-[dimethyl(sulfanyl)-λ4-sulfanyl]propyl]-5-(trifluoromethyl)pyrimidine-2,4-diamine?
2-N-[(1R)-1-[dimethyl(sulfanyl)-λ4-sulfanyl]propyl]-5-(trifluoromethyl)pyrimidine-2,4-diamine has a molecular weight of 314.40 g/mol, XLogP of 3.13, 4 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-N-[(1R)-1-[dimethyl(sulfanyl)-λ4-sulfanyl]propyl]-5-(trifluoromethyl)pyrimidine-2,4-diamine is sourced from PubChem (CID 154988494), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).