C81H92N24O12S2 — CID 154988618
CID 154988618 (PubChem CID 154988618) has the molecular formula C81H92N24O12S2 and a molecular weight of 1657.92 g/mol.
| Compound Name | CID 154988618 |
|---|---|
| PubChem CID | 154988618 |
| Molecular Formula | C81H92N24O12S2 |
| Molecular Weight | 1657.92 g/mol |
| Exact Mass | 1656.68 |
| IUPAC Name | — |
| SMILES | O=C1N[C@H]2CSS[C@H](NC(=O)[C@H](Cc3c[nH]c4ccccc34)NC(=O)[C@H](Cc3c[nH]cn3)NC(=O)[C@@H](Cc3ccccc3)NC(=O)[C@H](Cc3c[nH]cn3)NC(=O)C3(CCNCC3)NC2=O)C(=O)NC2(CCNCC2)C(=O)N[C@@H](Cc2c[nH]cn2)C(=O)N[C@H](Cc2ccccc2)C(=O)N[C@@H](Cc2c[nH]cn2)C(=O)N[C@H]1Cc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C81H92N24O12S2/c106-67-58(27-46-11-3-1-4-12-46)95-73(112)65(34-53-40-87-45-93-53)102-79(117)81(21-25-83-26-22-81)105-76(115)77-103-74(113)61(30-49-36-89-57-18-10-8-16-55(49)57)97-71(110)63(32-51-38-85-43-91-51)99-68(107)59(28-47-13-5-2-6-14-47)94-72(111)64(33-52-39-86-44-92-52)101-78(116)80(19-23-82-24-20-80)104-75(114)66(41-118-119-77)100-69(108)60(29-48-35-88-56-17-9-7-15-54(48)56)96-70(109)62(98-67)31-50-37-84-42-90-50/h1-18,35-40,42-45,58-66,77,82-83,88-89H,19-34,41H2,(H,84,90)(H,85,91)(H,86,92)(H,87,93)(H,94,111)(H,95,112)(H,96,109)(H,97,110)(H,98,106)(H,99,107)(H,100,108)(H,101,116)(H,102,117)(H,103,113)(H,104,114)(H,105,115)/t58-,59-,60+,61+,62+,63+,64+,65+,66+,77+/m1/s1 |
| InChIKey | FTAPOFDZIMMYRA-INYNPOLPSA-N |
| XLogP | -0.53 |
| TPSA | 519.56 Ų |
| H-Bond Donors | 20 |
| H-Bond Acceptors | 20 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 119 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1657.92 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 20 |
| H-Bond Acceptors ≤ 10 | 20 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|