C11H13N3O3S2 — CID 154989865
5-(2-amino-4-methyl-1,3-thiazol-5-yl)-2-methoxybenzenesulfonamide (PubChem CID 154989865) has the molecular formula C11H13N3O3S2 and a molecular weight of 299.38 g/mol. Its IUPAC name is 5-(2-amino-4-methyl-1,3-thiazol-5-yl)-2-methoxybenzenesulfonamide.
| Compound Name | 5-(2-amino-4-methyl-1,3-thiazol-5-yl)-2-methoxybenzenesulfonamide |
|---|---|
| PubChem CID | 154989865 |
| Molecular Formula | C11H13N3O3S2 |
| Molecular Weight | 299.38 g/mol |
| Exact Mass | 299.04 |
| IUPAC Name | 5-(2-amino-4-methyl-1,3-thiazol-5-yl)-2-methoxybenzenesulfonamide |
| SMILES | COc1ccc(-c2sc(N)nc2C)cc1S(N)(=O)=O |
| InChI | InChI=1S/C11H13N3O3S2/c1-6-10(18-11(12)14-6)7-3-4-8(17-2)9(5-7)19(13,15)16/h3-5H,1-2H3,(H2,12,14)(H2,13,15,16) |
| InChIKey | IHWISEUZJLRLGE-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 108.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.38 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |