C49H32N8S2 — CID 154990044
4,6-di(phenothiazin-10-yl)-N,N-bis(4-pyridin-4-ylphenyl)-1,3,5-triazin-2-amine (PubChem CID 154990044) has the molecular formula C49H32N8S2 and a molecular weight of 796.99 g/mol. Its IUPAC name is 4,6-di(phenothiazin-10-yl)-N,N-bis(4-pyridin-4-ylphenyl)-1,3,5-triazin-2-amine.
| Compound Name | 4,6-di(phenothiazin-10-yl)-N,N-bis(4-pyridin-4-ylphenyl)-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 154990044 |
| Molecular Formula | C49H32N8S2 |
| Molecular Weight | 796.99 g/mol |
| Exact Mass | 796.22 |
| IUPAC Name | 4,6-di(phenothiazin-10-yl)-N,N-bis(4-pyridin-4-ylphenyl)-1,3,5-triazin-2-amine |
| SMILES | c1ccc2c(c1)Sc1ccccc1N2c1nc(N(c2ccc(-c3ccncc3)cc2)c2ccc(-c3ccncc3)cc2)nc(N2c3ccccc3Sc3ccccc32)n1 |
| InChI | InChI=1S/C49H32N8S2/c1-5-13-43-39(9-1)56(40-10-2-6-14-44(40)58-43)48-52-47(53-49(54-48)57-41-11-3-7-15-45(41)59-46-16-8-4-12-42(46)57)55(37-21-17-33(18-22-37)35-25-29-50-30-26-35)38-23-19-34(20-24-38)36-27-31-51-32-28-36/h1-32H |
| InChIKey | IWOKEUMEJUEJSS-UHFFFAOYSA-N |
| XLogP | 13.33 |
| TPSA | 74.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 796.99 |
| LogP ≤ 5 | 13.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |