C23H30O4 — CID 154990076
[3,5-dimethyl-4-[(3E,5E)-6-(2-methylprop-2-enoyloxy)hepta-3,5-dien-3-yl]cyclohexa-1,3-dien-1-yl] 2-methylprop-2-enoate (PubChem CID 154990076) has the molecular formula C23H30O4 and a molecular weight of 370.49 g/mol. Its IUPAC name is [3,5-dimethyl-4-[(3E,5E)-6-(2-methylprop-2-enoyloxy)hepta-3,5-dien-3-yl]cyclohexa-1,3-dien-1-yl] 2-methylprop-2-enoate.
| Compound Name | [3,5-dimethyl-4-[(3E,5E)-6-(2-methylprop-2-enoyloxy)hepta-3,5-dien-3-yl]cyclohexa-1,3-dien-1-yl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 154990076 |
| Molecular Formula | C23H30O4 |
| Molecular Weight | 370.49 g/mol |
| Exact Mass | 370.21 |
| IUPAC Name | [3,5-dimethyl-4-[(3E,5E)-6-(2-methylprop-2-enoyloxy)hepta-3,5-dien-3-yl]cyclohexa-1,3-dien-1-yl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC1=CC(C)=C(/C(=C/C=C(\C)OC(=O)C(=C)C)CC)C(C)C1 |
| InChI | InChI=1S/C23H30O4/c1-9-19(11-10-18(8)26-22(24)14(2)3)21-16(6)12-20(13-17(21)7)27-23(25)15(4)5/h10-12,17H,2,4,9,13H2,1,3,5-8H3/b18-10+,19-11+ |
| InChIKey | IYKHBFIPWLITSK-XOBNHNQQSA-N |
| XLogP | 5.71 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.49 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|