About (6R)-6-(aminomethyl)-4,5-difluorocyclohexa-2,4-dien-1-ol
(6R)-6-(aminomethyl)-4,5-difluorocyclohexa-2,4-dien-1-ol (PubChem CID 154990201) has the molecular formula C7H9F2NO
and a molecular weight of 161.15 g/mol. Its IUPAC name is (6R)-6-(aminomethyl)-4,5-difluorocyclohexa-2,4-dien-1-ol.
Molecular Properties
| Compound Name | (6R)-6-(aminomethyl)-4,5-difluorocyclohexa-2,4-dien-1-ol |
| PubChem CID | 154990201 |
| Molecular Formula | C7H9F2NO |
| Molecular Weight | 161.15 g/mol |
| Exact Mass | 161.07 |
| IUPAC Name | (6R)-6-(aminomethyl)-4,5-difluorocyclohexa-2,4-dien-1-ol |
| SMILES | NC[C@H]1C(F)=C(F)C=CC1O |
| InChI | InChI=1S/C7H9F2NO/c8-5-1-2-6(11)4(3-10)7(5)9/h1-2,4,6,11H,3,10H2/t4-,6?/m1/s1 |
| InChIKey | DFPUDEJPZXQYFE-NJXYFUOMSA-N |
| XLogP | 0.64 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.15 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (6R)-6-(aminomethyl)-4,5-difluorocyclohexa-2,4-dien-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6R)-6-(aminomethyl)-4,5-difluorocyclohexa-2,4-dien-1-ol?
The IUPAC name of (6R)-6-(aminomethyl)-4,5-difluorocyclohexa-2,4-dien-1-ol (CID 154990201) is (6R)-6-(aminomethyl)-4,5-difluorocyclohexa-2,4-dien-1-ol.
What is the SMILES notation for (6R)-6-(aminomethyl)-4,5-difluorocyclohexa-2,4-dien-1-ol?
The canonical SMILES for (6R)-6-(aminomethyl)-4,5-difluorocyclohexa-2,4-dien-1-ol is NC[C@H]1C(F)=C(F)C=CC1O.
What is the InChIKey of (6R)-6-(aminomethyl)-4,5-difluorocyclohexa-2,4-dien-1-ol?
The InChIKey is DFPUDEJPZXQYFE-NJXYFUOMSA-N. The full InChI is InChI=1S/C7H9F2NO/c8-5-1-2-6(11)4(3-10)7(5)9/h1-2,4,6,11H,3,10H2/t4-,6?/m1/s1.
What are the key properties of (6R)-6-(aminomethyl)-4,5-difluorocyclohexa-2,4-dien-1-ol?
(6R)-6-(aminomethyl)-4,5-difluorocyclohexa-2,4-dien-1-ol has a molecular weight of 161.15 g/mol, XLogP of 0.64, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (6R)-6-(aminomethyl)-4,5-difluorocyclohexa-2,4-dien-1-ol is sourced from PubChem (CID 154990201), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).