C18H11F4N3O3 — CID 15499026
ethyl 1-(pyridine-4-carbonyl)-5-(2,3,4,5-tetrafluorophenyl)pyrazole-4-carboxylate (PubChem CID 15499026) has the molecular formula C18H11F4N3O3 and a molecular weight of 393.30 g/mol. Its IUPAC name is ethyl 1-(pyridine-4-carbonyl)-5-(2,3,4,5-tetrafluorophenyl)pyrazole-4-carboxylate.
| Compound Name | ethyl 1-(pyridine-4-carbonyl)-5-(2,3,4,5-tetrafluorophenyl)pyrazole-4-carboxylate |
|---|---|
| PubChem CID | 15499026 |
| Molecular Formula | C18H11F4N3O3 |
| Molecular Weight | 393.30 g/mol |
| Exact Mass | 393.07 |
| IUPAC Name | ethyl 1-(pyridine-4-carbonyl)-5-(2,3,4,5-tetrafluorophenyl)pyrazole-4-carboxylate |
| SMILES | CCOC(=O)c1cnn(C(=O)c2ccncc2)c1-c1cc(F)c(F)c(F)c1F |
| InChI | InChI=1S/C18H11F4N3O3/c1-2-28-18(27)11-8-24-25(17(26)9-3-5-23-6-4-9)16(11)10-7-12(19)14(21)15(22)13(10)20/h3-8H,2H2,1H3 |
| InChIKey | IMFUCPNESXSKGC-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 74.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.30 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|