C12H8F4N2O2 — CID 15499027
ethyl 5-(2,3,4,5-tetrafluorophenyl)-1H-pyrazole-4-carboxylate (PubChem CID 15499027) has the molecular formula C12H8F4N2O2 and a molecular weight of 288.20 g/mol. Its IUPAC name is ethyl 5-(2,3,4,5-tetrafluorophenyl)-1H-pyrazole-4-carboxylate.
| Compound Name | ethyl 5-(2,3,4,5-tetrafluorophenyl)-1H-pyrazole-4-carboxylate |
|---|---|
| PubChem CID | 15499027 |
| Molecular Formula | C12H8F4N2O2 |
| Molecular Weight | 288.20 g/mol |
| Exact Mass | 288.05 |
| IUPAC Name | ethyl 5-(2,3,4,5-tetrafluorophenyl)-1H-pyrazole-4-carboxylate |
| SMILES | CCOC(=O)c1cn[nH]c1-c1cc(F)c(F)c(F)c1F |
| InChI | InChI=1S/C12H8F4N2O2/c1-2-20-12(19)6-4-17-18-11(6)5-3-7(13)9(15)10(16)8(5)14/h3-4H,2H2,1H3,(H,17,18) |
| InChIKey | NERLPPQVXKXDMT-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.20 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|