About (1R)-3,3,3-trichloro-1-(methyldisulfanyl)propan-1-amine
(1R)-3,3,3-trichloro-1-(methyldisulfanyl)propan-1-amine (PubChem CID 154990295) has the molecular formula C4H8Cl3NS2
and a molecular weight of 240.61 g/mol. Its IUPAC name is (1R)-3,3,3-trichloro-1-(methyldisulfanyl)propan-1-amine.
Molecular Properties
| Compound Name | (1R)-3,3,3-trichloro-1-(methyldisulfanyl)propan-1-amine |
| PubChem CID | 154990295 |
| Molecular Formula | C4H8Cl3NS2 |
| Molecular Weight | 240.61 g/mol |
| Exact Mass | 238.92 |
| IUPAC Name | (1R)-3,3,3-trichloro-1-(methyldisulfanyl)propan-1-amine |
| SMILES | CSS[C@@H](N)CC(Cl)(Cl)Cl |
| InChI | InChI=1S/C4H8Cl3NS2/c1-9-10-3(8)2-4(5,6)7/h3H,2,8H2,1H3/t3-/m1/s1 |
| InChIKey | MNEWMJMMPKFXSW-GSVOUGTGSA-N |
| XLogP | 3.04 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.61 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze (1R)-3,3,3-trichloro-1-(methyldisulfanyl)propan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R)-3,3,3-trichloro-1-(methyldisulfanyl)propan-1-amine?
The IUPAC name of (1R)-3,3,3-trichloro-1-(methyldisulfanyl)propan-1-amine (CID 154990295) is (1R)-3,3,3-trichloro-1-(methyldisulfanyl)propan-1-amine.
What is the SMILES notation for (1R)-3,3,3-trichloro-1-(methyldisulfanyl)propan-1-amine?
The canonical SMILES for (1R)-3,3,3-trichloro-1-(methyldisulfanyl)propan-1-amine is CSS[C@@H](N)CC(Cl)(Cl)Cl.
What is the InChIKey of (1R)-3,3,3-trichloro-1-(methyldisulfanyl)propan-1-amine?
The InChIKey is MNEWMJMMPKFXSW-GSVOUGTGSA-N. The full InChI is InChI=1S/C4H8Cl3NS2/c1-9-10-3(8)2-4(5,6)7/h3H,2,8H2,1H3/t3-/m1/s1.
What are the key properties of (1R)-3,3,3-trichloro-1-(methyldisulfanyl)propan-1-amine?
(1R)-3,3,3-trichloro-1-(methyldisulfanyl)propan-1-amine has a molecular weight of 240.61 g/mol, XLogP of 3.04, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1R)-3,3,3-trichloro-1-(methyldisulfanyl)propan-1-amine is sourced from PubChem (CID 154990295), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).