About 2,7-dichloro-8-fluoro-4-piperazin-1-ylpyrido[4,3-d]pyrimidine
2,7-dichloro-8-fluoro-4-piperazin-1-ylpyrido[4,3-d]pyrimidine (PubChem CID 154990721) has the molecular formula C11H10Cl2FN5
and a molecular weight of 302.14 g/mol. Its IUPAC name is 2,7-dichloro-8-fluoro-4-piperazin-1-ylpyrido[4,3-d]pyrimidine.
Molecular Properties
| Compound Name | 2,7-dichloro-8-fluoro-4-piperazin-1-ylpyrido[4,3-d]pyrimidine |
| PubChem CID | 154990721 |
| Molecular Formula | C11H10Cl2FN5 |
| Molecular Weight | 302.14 g/mol |
| Exact Mass | 301.03 |
| IUPAC Name | 2,7-dichloro-8-fluoro-4-piperazin-1-ylpyrido[4,3-d]pyrimidine |
| SMILES | Fc1c(Cl)ncc2c(N3CCNCC3)nc(Cl)nc12 |
| InChI | InChI=1S/C11H10Cl2FN5/c12-9-7(14)8-6(5-16-9)10(18-11(13)17-8)19-3-1-15-2-4-19/h5,15H,1-4H2 |
| InChIKey | SIPUKFSXBAVAST-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 53.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.14 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 2,7-dichloro-8-fluoro-4-piperazin-1-ylpyrido[4,3-d]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,7-dichloro-8-fluoro-4-piperazin-1-ylpyrido[4,3-d]pyrimidine?
The IUPAC name of 2,7-dichloro-8-fluoro-4-piperazin-1-ylpyrido[4,3-d]pyrimidine (CID 154990721) is 2,7-dichloro-8-fluoro-4-piperazin-1-ylpyrido[4,3-d]pyrimidine.
What is the SMILES notation for 2,7-dichloro-8-fluoro-4-piperazin-1-ylpyrido[4,3-d]pyrimidine?
The canonical SMILES for 2,7-dichloro-8-fluoro-4-piperazin-1-ylpyrido[4,3-d]pyrimidine is Fc1c(Cl)ncc2c(N3CCNCC3)nc(Cl)nc12.
What is the InChIKey of 2,7-dichloro-8-fluoro-4-piperazin-1-ylpyrido[4,3-d]pyrimidine?
The InChIKey is SIPUKFSXBAVAST-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10Cl2FN5/c12-9-7(14)8-6(5-16-9)10(18-11(13)17-8)19-3-1-15-2-4-19/h5,15H,1-4H2.
What are the key properties of 2,7-dichloro-8-fluoro-4-piperazin-1-ylpyrido[4,3-d]pyrimidine?
2,7-dichloro-8-fluoro-4-piperazin-1-ylpyrido[4,3-d]pyrimidine has a molecular weight of 302.14 g/mol, XLogP of 1.88, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2,7-dichloro-8-fluoro-4-piperazin-1-ylpyrido[4,3-d]pyrimidine is sourced from PubChem (CID 154990721), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).