About benzyl 4-[[4-(2,6-difluorophenyl)-5-oxotetrazol-1-yl]methyl-ethylamino]benzoate
benzyl 4-[[4-(2,6-difluorophenyl)-5-oxotetrazol-1-yl]methyl-ethylamino]benzoate (PubChem CID 154990851) has the molecular formula C24H21F2N5O3
and a molecular weight of 465.46 g/mol. Its IUPAC name is benzyl 4-[[4-(2,6-difluorophenyl)-5-oxotetrazol-1-yl]methyl-ethylamino]benzoate.
Molecular Properties
| Compound Name | benzyl 4-[[4-(2,6-difluorophenyl)-5-oxotetrazol-1-yl]methyl-ethylamino]benzoate |
| PubChem CID | 154990851 |
| Molecular Formula | C24H21F2N5O3 |
| Molecular Weight | 465.46 g/mol |
| Exact Mass | 465.16 |
| IUPAC Name | benzyl 4-[[4-(2,6-difluorophenyl)-5-oxotetrazol-1-yl]methyl-ethylamino]benzoate |
| SMILES | CCN(Cn1nnn(-c2c(F)cccc2F)c1=O)c1ccc(C(=O)OCc2ccccc2)cc1 |
| InChI | InChI=1S/C24H21F2N5O3/c1-2-29(16-30-24(33)31(28-27-30)22-20(25)9-6-10-21(22)26)19-13-11-18(12-14-19)23(32)34-15-17-7-4-3-5-8-17/h3-14H,2,15-16H2,1H3 |
| InChIKey | RBNJRVQHECBNIS-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 82.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 465.46 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze benzyl 4-[[4-(2,6-difluorophenyl)-5-oxotetrazol-1-yl]methyl-ethylamino]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl 4-[[4-(2,6-difluorophenyl)-5-oxotetrazol-1-yl]methyl-ethylamino]benzoate?
The IUPAC name of benzyl 4-[[4-(2,6-difluorophenyl)-5-oxotetrazol-1-yl]methyl-ethylamino]benzoate (CID 154990851) is benzyl 4-[[4-(2,6-difluorophenyl)-5-oxotetrazol-1-yl]methyl-ethylamino]benzoate.
What is the SMILES notation for benzyl 4-[[4-(2,6-difluorophenyl)-5-oxotetrazol-1-yl]methyl-ethylamino]benzoate?
The canonical SMILES for benzyl 4-[[4-(2,6-difluorophenyl)-5-oxotetrazol-1-yl]methyl-ethylamino]benzoate is CCN(Cn1nnn(-c2c(F)cccc2F)c1=O)c1ccc(C(=O)OCc2ccccc2)cc1.
What is the InChIKey of benzyl 4-[[4-(2,6-difluorophenyl)-5-oxotetrazol-1-yl]methyl-ethylamino]benzoate?
The InChIKey is RBNJRVQHECBNIS-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H21F2N5O3/c1-2-29(16-30-24(33)31(28-27-30)22-20(25)9-6-10-21(22)26)19-13-11-18(12-14-19)23(32)34-15-17-7-4-3-5-8-17/h3-14H,2,15-16H2,1H3.
What are the key properties of benzyl 4-[[4-(2,6-difluorophenyl)-5-oxotetrazol-1-yl]methyl-ethylamino]benzoate?
benzyl 4-[[4-(2,6-difluorophenyl)-5-oxotetrazol-1-yl]methyl-ethylamino]benzoate has a molecular weight of 465.46 g/mol, XLogP of 3.55, 8 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl 4-[[4-(2,6-difluorophenyl)-5-oxotetrazol-1-yl]methyl-ethylamino]benzoate is sourced from PubChem (CID 154990851), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).