About 4-[[4-(2,6-difluorophenyl)-5-oxotetrazol-1-yl]methyl-ethylamino]benzoic acid
4-[[4-(2,6-difluorophenyl)-5-oxotetrazol-1-yl]methyl-ethylamino]benzoic acid (PubChem CID 154990934) has the molecular formula C17H15F2N5O3
and a molecular weight of 375.34 g/mol. Its IUPAC name is 4-[[4-(2,6-difluorophenyl)-5-oxotetrazol-1-yl]methyl-ethylamino]benzoic acid.
Molecular Properties
| Compound Name | 4-[[4-(2,6-difluorophenyl)-5-oxotetrazol-1-yl]methyl-ethylamino]benzoic acid |
| PubChem CID | 154990934 |
| Molecular Formula | C17H15F2N5O3 |
| Molecular Weight | 375.34 g/mol |
| Exact Mass | 375.11 |
| IUPAC Name | 4-[[4-(2,6-difluorophenyl)-5-oxotetrazol-1-yl]methyl-ethylamino]benzoic acid |
| SMILES | CCN(Cn1nnn(-c2c(F)cccc2F)c1=O)c1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C17H15F2N5O3/c1-2-22(12-8-6-11(7-9-12)16(25)26)10-23-17(27)24(21-20-23)15-13(18)4-3-5-14(15)19/h3-9H,2,10H2,1H3,(H,25,26) |
| InChIKey | JEULTDVQWDRAFF-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 93.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 375.34 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 4-[[4-(2,6-difluorophenyl)-5-oxotetrazol-1-yl]methyl-ethylamino]benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[4-(2,6-difluorophenyl)-5-oxotetrazol-1-yl]methyl-ethylamino]benzoic acid?
The IUPAC name of 4-[[4-(2,6-difluorophenyl)-5-oxotetrazol-1-yl]methyl-ethylamino]benzoic acid (CID 154990934) is 4-[[4-(2,6-difluorophenyl)-5-oxotetrazol-1-yl]methyl-ethylamino]benzoic acid.
What is the SMILES notation for 4-[[4-(2,6-difluorophenyl)-5-oxotetrazol-1-yl]methyl-ethylamino]benzoic acid?
The canonical SMILES for 4-[[4-(2,6-difluorophenyl)-5-oxotetrazol-1-yl]methyl-ethylamino]benzoic acid is CCN(Cn1nnn(-c2c(F)cccc2F)c1=O)c1ccc(C(=O)O)cc1.
What is the InChIKey of 4-[[4-(2,6-difluorophenyl)-5-oxotetrazol-1-yl]methyl-ethylamino]benzoic acid?
The InChIKey is JEULTDVQWDRAFF-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H15F2N5O3/c1-2-22(12-8-6-11(7-9-12)16(25)26)10-23-17(27)24(21-20-23)15-13(18)4-3-5-14(15)19/h3-9H,2,10H2,1H3,(H,25,26).
What are the key properties of 4-[[4-(2,6-difluorophenyl)-5-oxotetrazol-1-yl]methyl-ethylamino]benzoic acid?
4-[[4-(2,6-difluorophenyl)-5-oxotetrazol-1-yl]methyl-ethylamino]benzoic acid has a molecular weight of 375.34 g/mol, XLogP of 1.89, 6 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[4-(2,6-difluorophenyl)-5-oxotetrazol-1-yl]methyl-ethylamino]benzoic acid is sourced from PubChem (CID 154990934), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).