C13H17F3N2O — CID 154991826
1-ethyl-4-[(3E,5E)-7,7,7-trifluoro-6-methylhepta-1,3,5-trien-3-yl]imidazolidin-2-one (PubChem CID 154991826) has the molecular formula C13H17F3N2O and a molecular weight of 274.29 g/mol. Its IUPAC name is 1-ethyl-4-[(3E,5E)-7,7,7-trifluoro-6-methylhepta-1,3,5-trien-3-yl]imidazolidin-2-one.
| Compound Name | 1-ethyl-4-[(3E,5E)-7,7,7-trifluoro-6-methylhepta-1,3,5-trien-3-yl]imidazolidin-2-one |
|---|---|
| PubChem CID | 154991826 |
| Molecular Formula | C13H17F3N2O |
| Molecular Weight | 274.29 g/mol |
| Exact Mass | 274.13 |
| IUPAC Name | 1-ethyl-4-[(3E,5E)-7,7,7-trifluoro-6-methylhepta-1,3,5-trien-3-yl]imidazolidin-2-one |
| SMILES | C=C/C(=C\C=C(/C)C(F)(F)F)C1CN(CC)C(=O)N1 |
| InChI | InChI=1S/C13H17F3N2O/c1-4-10(7-6-9(3)13(14,15)16)11-8-18(5-2)12(19)17-11/h4,6-7,11H,1,5,8H2,2-3H3,(H,17,19)/b9-6+,10-7+ |
| InChIKey | TXUMCQKXVHGLDS-KZZDLZNXSA-N |
| XLogP | 3.02 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.29 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|