About 1-[(1Z,3Z)-2-propan-2-ylpenta-1,3-dienyl]-1-pyridin-4-ylhydrazine
1-[(1Z,3Z)-2-propan-2-ylpenta-1,3-dienyl]-1-pyridin-4-ylhydrazine (PubChem CID 154991943) has the molecular formula C13H19N3
and a molecular weight of 217.32 g/mol. Its IUPAC name is 1-[(1Z,3Z)-2-propan-2-ylpenta-1,3-dienyl]-1-pyridin-4-ylhydrazine.
Molecular Properties
| Compound Name | 1-[(1Z,3Z)-2-propan-2-ylpenta-1,3-dienyl]-1-pyridin-4-ylhydrazine |
| PubChem CID | 154991943 |
| Molecular Formula | C13H19N3 |
| Molecular Weight | 217.32 g/mol |
| Exact Mass | 217.16 |
| IUPAC Name | 1-[(1Z,3Z)-2-propan-2-ylpenta-1,3-dienyl]-1-pyridin-4-ylhydrazine |
| SMILES | C/C=C\C(=C/N(N)c1ccncc1)C(C)C |
| InChI | InChI=1S/C13H19N3/c1-4-5-12(11(2)3)10-16(14)13-6-8-15-9-7-13/h4-11H,14H2,1-3H3/b5-4-,12-10+ |
| InChIKey | BQUCRXNIEJEXPX-KYTHIUCFSA-N |
| XLogP | 2.88 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.32 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 1-[(1Z,3Z)-2-propan-2-ylpenta-1,3-dienyl]-1-pyridin-4-ylhydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(1Z,3Z)-2-propan-2-ylpenta-1,3-dienyl]-1-pyridin-4-ylhydrazine?
The IUPAC name of 1-[(1Z,3Z)-2-propan-2-ylpenta-1,3-dienyl]-1-pyridin-4-ylhydrazine (CID 154991943) is 1-[(1Z,3Z)-2-propan-2-ylpenta-1,3-dienyl]-1-pyridin-4-ylhydrazine.
What is the SMILES notation for 1-[(1Z,3Z)-2-propan-2-ylpenta-1,3-dienyl]-1-pyridin-4-ylhydrazine?
The canonical SMILES for 1-[(1Z,3Z)-2-propan-2-ylpenta-1,3-dienyl]-1-pyridin-4-ylhydrazine is C/C=C\C(=C/N(N)c1ccncc1)C(C)C.
What is the InChIKey of 1-[(1Z,3Z)-2-propan-2-ylpenta-1,3-dienyl]-1-pyridin-4-ylhydrazine?
The InChIKey is BQUCRXNIEJEXPX-KYTHIUCFSA-N. The full InChI is InChI=1S/C13H19N3/c1-4-5-12(11(2)3)10-16(14)13-6-8-15-9-7-13/h4-11H,14H2,1-3H3/b5-4-,12-10+.
What are the key properties of 1-[(1Z,3Z)-2-propan-2-ylpenta-1,3-dienyl]-1-pyridin-4-ylhydrazine?
1-[(1Z,3Z)-2-propan-2-ylpenta-1,3-dienyl]-1-pyridin-4-ylhydrazine has a molecular weight of 217.32 g/mol, XLogP of 2.88, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(1Z,3Z)-2-propan-2-ylpenta-1,3-dienyl]-1-pyridin-4-ylhydrazine is sourced from PubChem (CID 154991943), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).