C37H56N6O8 — CID 154992248
tert-butyl 7-[(7R)-7-[6-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethoxy]-3-pyridinyl]-9-ethoxy-9-oxononyl]-3,4-dihydro-2H-1,8-naphthyridine-1-carboxylate (PubChem CID 154992248) has the molecular formula C37H56N6O8 and a molecular weight of 712.89 g/mol. Its IUPAC name is tert-butyl 7-[(7R)-7-[6-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethoxy]-3-pyridinyl]-9-ethoxy-9-oxononyl]-3,4-dihydro-2H-1,8-naphthyridine-1-carboxylate.
| Compound Name | tert-butyl 7-[(7R)-7-[6-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethoxy]-3-pyridinyl]-9-ethoxy-9-oxononyl]-3,4-dihydro-2H-1,8-naphthyridine-1-carboxylate |
|---|---|
| PubChem CID | 154992248 |
| Molecular Formula | C37H56N6O8 |
| Molecular Weight | 712.89 g/mol |
| Exact Mass | 712.42 |
| IUPAC Name | tert-butyl 7-[(7R)-7-[6-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethoxy]-3-pyridinyl]-9-ethoxy-9-oxononyl]-3,4-dihydro-2H-1,8-naphthyridine-1-carboxylate |
| SMILES | CCOC(=O)C[C@@H](CCCCCCc1ccc2c(n1)N(C(=O)OC(C)(C)C)CCC2)c1ccc(OCCOCCOCCOCCN=[N+]=[N-])nc1 |
| InChI | InChI=1S/C37H56N6O8/c1-5-49-34(44)27-30(31-15-17-33(39-28-31)50-26-25-48-24-23-47-22-21-46-20-18-40-42-38)11-8-6-7-9-13-32-16-14-29-12-10-19-43(35(29)41-32)36(45)51-37(2,3)4/h14-17,28,30H,5-13,18-27H2,1-4H3/t30-/m1/s1 |
| InChIKey | IIXNNBVTEPVNOO-SSEXGKCCSA-N |
| XLogP | 7.13 |
| TPSA | 167.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 51 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 712.89 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|