C24H32F2O11S — CID 154992443
2-[4-[5-[(8-ethyl-8-tricyclo[5.2.1.02,6]decanyl)oxycarbonyl]-2-oxooxolan-3-yl]oxy-4-oxobutanoyl]oxy-1,1-difluoropropane-1-sulfonic acid (PubChem CID 154992443) has the molecular formula C24H32F2O11S and a molecular weight of 566.57 g/mol. Its IUPAC name is 2-[4-[5-[(8-ethyl-8-tricyclo[5.2.1.02,6]decanyl)oxycarbonyl]-2-oxooxolan-3-yl]oxy-4-oxobutanoyl]oxy-1,1-difluoropropane-1-sulfonic acid.
| Compound Name | 2-[4-[5-[(8-ethyl-8-tricyclo[5.2.1.02,6]decanyl)oxycarbonyl]-2-oxooxolan-3-yl]oxy-4-oxobutanoyl]oxy-1,1-difluoropropane-1-sulfonic acid |
|---|---|
| PubChem CID | 154992443 |
| Molecular Formula | C24H32F2O11S |
| Molecular Weight | 566.57 g/mol |
| Exact Mass | 566.16 |
| IUPAC Name | 2-[4-[5-[(8-ethyl-8-tricyclo[5.2.1.02,6]decanyl)oxycarbonyl]-2-oxooxolan-3-yl]oxy-4-oxobutanoyl]oxy-1,1-difluoropropane-1-sulfonic acid |
| SMILES | CCC1(OC(=O)C2CC(OC(=O)CCC(=O)OC(C)C(F)(F)S(=O)(=O)O)C(=O)O2)CC2CC1C1CCCC21 |
| InChI | InChI=1S/C24H32F2O11S/c1-3-23(11-13-9-16(23)15-6-4-5-14(13)15)37-22(30)18-10-17(21(29)36-18)35-20(28)8-7-19(27)34-12(2)24(25,26)38(31,32)33/h12-18H,3-11H2,1-2H3,(H,31,32,33) |
| InChIKey | MRDNIHVSFNVSEH-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 159.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.57 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|