C53H104N2O — CID 154992715
N-[3-(dimethylamino)propyl]-N-[(6Z,28Z)-9,32-dimethylheptatriaconta-6,28-dien-19-yl]-2-ethylheptanamide (PubChem CID 154992715) has the molecular formula C53H104N2O and a molecular weight of 785.43 g/mol. Its IUPAC name is N-[3-(dimethylamino)propyl]-N-[(6Z,28Z)-9,32-dimethylheptatriaconta-6,28-dien-19-yl]-2-ethylheptanamide.
| Compound Name | N-[3-(dimethylamino)propyl]-N-[(6Z,28Z)-9,32-dimethylheptatriaconta-6,28-dien-19-yl]-2-ethylheptanamide |
|---|---|
| PubChem CID | 154992715 |
| Molecular Formula | C53H104N2O |
| Molecular Weight | 785.43 g/mol |
| Exact Mass | 784.81 |
| IUPAC Name | N-[3-(dimethylamino)propyl]-N-[(6Z,28Z)-9,32-dimethylheptatriaconta-6,28-dien-19-yl]-2-ethylheptanamide |
| SMILES | CCCCC/C=C\CC(C)CCCCCCCCCC(CCCCCCCC/C=C\CCC(C)CCCCC)N(CCCN(C)C)C(=O)C(CC)CCCCC |
| InChI | InChI=1S/C53H104N2O/c1-9-13-16-17-27-34-42-50(6)43-36-29-24-22-26-31-38-46-52(55(48-39-47-54(7)8)53(56)51(12-4)44-33-15-11-3)45-37-30-25-21-19-18-20-23-28-35-41-49(5)40-32-14-10-2/h23,27-28,34,49-52H,9-22,24-26,29-33,35-48H2,1-8H3/b28-23-,34-27- |
| InChIKey | QOPKWTOOOUKLSQ-HMKVBUSPSA-N |
| XLogP | 17.09 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 43 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 785.43 |
| LogP ≤ 5 | 17.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|