C14H24N2 — CID 154992810
(2R,4E,6Z)-8-but-1-enylimino-N,4-dimethylocta-4,6-dien-2-amine (PubChem CID 154992810) has the molecular formula C14H24N2 and a molecular weight of 220.36 g/mol. Its IUPAC name is (2R,4E,6Z)-8-but-1-enylimino-N,4-dimethylocta-4,6-dien-2-amine.
| Compound Name | (2R,4E,6Z)-8-but-1-enylimino-N,4-dimethylocta-4,6-dien-2-amine |
|---|---|
| PubChem CID | 154992810 |
| Molecular Formula | C14H24N2 |
| Molecular Weight | 220.36 g/mol |
| Exact Mass | 220.19 |
| IUPAC Name | (2R,4E,6Z)-8-but-1-enylimino-N,4-dimethylocta-4,6-dien-2-amine |
| SMILES | CCC=C/N=C/C=C\C=C(/C)C[C@@H](C)NC |
| InChI | InChI=1S/C14H24N2/c1-5-6-10-16-11-8-7-9-13(2)12-14(3)15-4/h6-11,14-15H,5,12H2,1-4H3/b8-7-,10-6?,13-9+,16-11+/t14-/m1/s1 |
| InChIKey | WYSUQQZPJGXLQQ-BOQVAHSLSA-N |
| XLogP | 3.48 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.36 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|