C20H33FN2 — CID 154993301
1-cyclohexa-2,4-dien-1-yl-4-(3,3-dimethyl-2-methylidenepentyl)imino-3-fluoro-N-methylpentan-1-amine (PubChem CID 154993301) has the molecular formula C20H33FN2 and a molecular weight of 320.50 g/mol. Its IUPAC name is 1-cyclohexa-2,4-dien-1-yl-4-(3,3-dimethyl-2-methylidenepentyl)imino-3-fluoro-N-methylpentan-1-amine.
| Compound Name | 1-cyclohexa-2,4-dien-1-yl-4-(3,3-dimethyl-2-methylidenepentyl)imino-3-fluoro-N-methylpentan-1-amine |
|---|---|
| PubChem CID | 154993301 |
| Molecular Formula | C20H33FN2 |
| Molecular Weight | 320.50 g/mol |
| Exact Mass | 320.26 |
| IUPAC Name | 1-cyclohexa-2,4-dien-1-yl-4-(3,3-dimethyl-2-methylidenepentyl)imino-3-fluoro-N-methylpentan-1-amine |
| SMILES | C=C(C/N=C(\C)C(F)CC(NC)C1C=CC=CC1)C(C)(C)CC |
| InChI | InChI=1S/C20H33FN2/c1-7-20(4,5)15(2)14-23-16(3)18(21)13-19(22-6)17-11-9-8-10-12-17/h8-11,17-19,22H,2,7,12-14H2,1,3-6H3/b23-16+ |
| InChIKey | CMBZSWHWSFHVCN-XQNSMLJCSA-N |
| XLogP | 4.89 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.50 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|