C19H27FN2 — CID 154993320
4-(3-cyclopropylbuta-1,3-dien-2-ylimino)-3-fluoro-1-(3-methylcyclohexa-2,4-dien-1-yl)pentan-1-amine (PubChem CID 154993320) has the molecular formula C19H27FN2 and a molecular weight of 302.44 g/mol. Its IUPAC name is 4-(3-cyclopropylbuta-1,3-dien-2-ylimino)-3-fluoro-1-(3-methylcyclohexa-2,4-dien-1-yl)pentan-1-amine.
| Compound Name | 4-(3-cyclopropylbuta-1,3-dien-2-ylimino)-3-fluoro-1-(3-methylcyclohexa-2,4-dien-1-yl)pentan-1-amine |
|---|---|
| PubChem CID | 154993320 |
| Molecular Formula | C19H27FN2 |
| Molecular Weight | 302.44 g/mol |
| Exact Mass | 302.22 |
| IUPAC Name | 4-(3-cyclopropylbuta-1,3-dien-2-ylimino)-3-fluoro-1-(3-methylcyclohexa-2,4-dien-1-yl)pentan-1-amine |
| SMILES | C=C(/N=C(\C)C(F)CC(N)C1C=C(C)C=CC1)C(=C)C1CC1 |
| InChI | InChI=1S/C19H27FN2/c1-12-6-5-7-17(10-12)19(21)11-18(20)15(4)22-14(3)13(2)16-8-9-16/h5-6,10,16-19H,2-3,7-9,11,21H2,1,4H3/b22-15+ |
| InChIKey | KXBNINJMFSVVHQ-PXLXIMEGSA-N |
| XLogP | 4.51 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.44 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|