C18H19ClF4N6O4S — CID 154993493
N-(4-chloro-3-methyl-1,2-thiazol-5-yl)-6-[[(Z)-[1-[ethyl(formyl)amino]-2-hydroxyethylidene]amino]-methylamino]-5-fluoro-2-(2,2,2-trifluoroethoxy)pyridine-3-carboxamide (PubChem CID 154993493) has the molecular formula C18H19ClF4N6O4S and a molecular weight of 526.90 g/mol. Its IUPAC name is N-(4-chloro-3-methyl-1,2-thiazol-5-yl)-6-[[(Z)-[1-[ethyl(formyl)amino]-2-hydroxyethylidene]amino]-methylamino]-5-fluoro-2-(2,2,2-trifluoroethoxy)pyridine-3-carboxamide.
| Compound Name | N-(4-chloro-3-methyl-1,2-thiazol-5-yl)-6-[[(Z)-[1-[ethyl(formyl)amino]-2-hydroxyethylidene]amino]-methylamino]-5-fluoro-2-(2,2,2-trifluoroethoxy)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 154993493 |
| Molecular Formula | C18H19ClF4N6O4S |
| Molecular Weight | 526.90 g/mol |
| Exact Mass | 526.08 |
| IUPAC Name | N-(4-chloro-3-methyl-1,2-thiazol-5-yl)-6-[[(Z)-[1-[ethyl(formyl)amino]-2-hydroxyethylidene]amino]-methylamino]-5-fluoro-2-(2,2,2-trifluoroethoxy)pyridine-3-carboxamide |
| SMILES | CCN(C=O)/C(CO)=N\N(C)c1nc(OCC(F)(F)F)c(C(=O)Nc2snc(C)c2Cl)cc1F |
| InChI | InChI=1S/C18H19ClF4N6O4S/c1-4-29(8-31)12(6-30)26-28(3)14-11(20)5-10(16(24-14)33-7-18(21,22)23)15(32)25-17-13(19)9(2)27-34-17/h5,8,30H,4,6-7H2,1-3H3,(H,25,32)/b26-12- |
| InChIKey | QOMODNXODXWWCQ-ZRGSRPPYSA-N |
| XLogP | 3.05 |
| TPSA | 120.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.90 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|