C48H79N — CID 154993824
2-buta-1,3-dien-2-yl-1-[3-[4-ethyl-3-[(5E,13E)-14-(3-ethylcyclohexyl)-5,13-dimethyl-8-methylidenetetradeca-5,13-dienyl]-2,6-dimethylcyclohexyl]buta-1,3-dien-2-yl]piperidine (PubChem CID 154993824) has the molecular formula C48H79N and a molecular weight of 670.17 g/mol. Its IUPAC name is 2-buta-1,3-dien-2-yl-1-[3-[4-ethyl-3-[(5E,13E)-14-(3-ethylcyclohexyl)-5,13-dimethyl-8-methylidenetetradeca-5,13-dienyl]-2,6-dimethylcyclohexyl]buta-1,3-dien-2-yl]piperidine.
| Compound Name | 2-buta-1,3-dien-2-yl-1-[3-[4-ethyl-3-[(5E,13E)-14-(3-ethylcyclohexyl)-5,13-dimethyl-8-methylidenetetradeca-5,13-dienyl]-2,6-dimethylcyclohexyl]buta-1,3-dien-2-yl]piperidine |
|---|---|
| PubChem CID | 154993824 |
| Molecular Formula | C48H79N |
| Molecular Weight | 670.17 g/mol |
| Exact Mass | 669.62 |
| IUPAC Name | 2-buta-1,3-dien-2-yl-1-[3-[4-ethyl-3-[(5E,13E)-14-(3-ethylcyclohexyl)-5,13-dimethyl-8-methylidenetetradeca-5,13-dienyl]-2,6-dimethylcyclohexyl]buta-1,3-dien-2-yl]piperidine |
| SMILES | C=CC(=C)C1CCCCN1C(=C)C(=C)C1C(C)CC(CC)C(CCCC/C(C)=C/CC(=C)CCCC/C(C)=C/C2CCCC(CC)C2)C1C |
| InChI | InChI=1S/C48H79N/c1-12-38(7)47-28-19-20-31-49(47)42(11)40(9)48-39(8)33-45(14-3)46(41(48)10)27-18-17-23-36(5)30-29-35(4)22-15-16-24-37(6)32-44-26-21-25-43(13-2)34-44/h12,30,32,39,41,43-48H,1,4,7,9,11,13-29,31,33-34H2,2-3,5-6,8,10H3/b36-30+,37-32+ |
| InChIKey | SXHSWBNAPWVMHC-YXUNZGCYSA-N |
| XLogP | 14.76 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.17 |
| LogP ≤ 5 | 14.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|