C20H21N3O3 — CID 154994400
3-[7-(piperidine-1-carbonyl)-2,3-dihydropyrido[3,2-b][1,4]oxazin-4-yl]benzaldehyde (PubChem CID 154994400) has the molecular formula C20H21N3O3 and a molecular weight of 351.41 g/mol. Its IUPAC name is 3-[7-(piperidine-1-carbonyl)-2,3-dihydropyrido[3,2-b][1,4]oxazin-4-yl]benzaldehyde.
| Compound Name | 3-[7-(piperidine-1-carbonyl)-2,3-dihydropyrido[3,2-b][1,4]oxazin-4-yl]benzaldehyde |
|---|---|
| PubChem CID | 154994400 |
| Molecular Formula | C20H21N3O3 |
| Molecular Weight | 351.41 g/mol |
| Exact Mass | 351.16 |
| IUPAC Name | 3-[7-(piperidine-1-carbonyl)-2,3-dihydropyrido[3,2-b][1,4]oxazin-4-yl]benzaldehyde |
| SMILES | O=Cc1cccc(N2CCOc3cc(C(=O)N4CCCCC4)cnc32)c1 |
| InChI | InChI=1S/C20H21N3O3/c24-14-15-5-4-6-17(11-15)23-9-10-26-18-12-16(13-21-19(18)23)20(25)22-7-2-1-3-8-22/h4-6,11-14H,1-3,7-10H2 |
| InChIKey | XRSYHPOMTMGKHH-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 62.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.41 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|