C21H23N7O4 — CID 154994898
2-ethyl-7-[7-(4-methyl-3-oxopiperazine-1-carbonyl)-2,3-dihydropyrido[3,2-b][1,4]oxazin-4-yl]-[1,2,4]triazolo[4,3-a]pyridin-3-one (PubChem CID 154994898) has the molecular formula C21H23N7O4 and a molecular weight of 437.46 g/mol. Its IUPAC name is 2-ethyl-7-[7-(4-methyl-3-oxopiperazine-1-carbonyl)-2,3-dihydropyrido[3,2-b][1,4]oxazin-4-yl]-[1,2,4]triazolo[4,3-a]pyridin-3-one.
| Compound Name | 2-ethyl-7-[7-(4-methyl-3-oxopiperazine-1-carbonyl)-2,3-dihydropyrido[3,2-b][1,4]oxazin-4-yl]-[1,2,4]triazolo[4,3-a]pyridin-3-one |
|---|---|
| PubChem CID | 154994898 |
| Molecular Formula | C21H23N7O4 |
| Molecular Weight | 437.46 g/mol |
| Exact Mass | 437.18 |
| IUPAC Name | 2-ethyl-7-[7-(4-methyl-3-oxopiperazine-1-carbonyl)-2,3-dihydropyrido[3,2-b][1,4]oxazin-4-yl]-[1,2,4]triazolo[4,3-a]pyridin-3-one |
| SMILES | CCn1nc2cc(N3CCOc4cc(C(=O)N5CCN(C)C(=O)C5)cnc43)ccn2c1=O |
| InChI | InChI=1S/C21H23N7O4/c1-3-28-21(31)27-5-4-15(11-17(27)23-28)26-8-9-32-16-10-14(12-22-19(16)26)20(30)25-7-6-24(2)18(29)13-25/h4-5,10-12H,3,6-9,13H2,1-2H3 |
| InChIKey | GLJZPIXYKUVLNJ-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 105.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.46 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |