About 3-(4-azidocyclohexyl)-4-methyl-5-[1-(3-propan-2-ylphenoxy)ethyl]-1,2,4-triazole
3-(4-azidocyclohexyl)-4-methyl-5-[1-(3-propan-2-ylphenoxy)ethyl]-1,2,4-triazole (PubChem CID 154995557) has the molecular formula C20H28N6O
and a molecular weight of 368.49 g/mol. Its IUPAC name is 3-(4-azidocyclohexyl)-4-methyl-5-[1-(3-propan-2-ylphenoxy)ethyl]-1,2,4-triazole.
Molecular Properties
| Compound Name | 3-(4-azidocyclohexyl)-4-methyl-5-[1-(3-propan-2-ylphenoxy)ethyl]-1,2,4-triazole |
| PubChem CID | 154995557 |
| Molecular Formula | C20H28N6O |
| Molecular Weight | 368.49 g/mol |
| Exact Mass | 368.23 |
| IUPAC Name | 3-(4-azidocyclohexyl)-4-methyl-5-[1-(3-propan-2-ylphenoxy)ethyl]-1,2,4-triazole |
| SMILES | CC(C)c1cccc(OC(C)c2nnc(C3CCC(N=[N+]=[N-])CC3)n2C)c1 |
| InChI | InChI=1S/C20H28N6O/c1-13(2)16-6-5-7-18(12-16)27-14(3)19-23-24-20(26(19)4)15-8-10-17(11-9-15)22-25-21/h5-7,12-15,17H,8-11H2,1-4H3 |
| InChIKey | OZYGLEYQHHBLKM-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 88.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 368.49 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 3-(4-azidocyclohexyl)-4-methyl-5-[1-(3-propan-2-ylphenoxy)ethyl]-1,2,4-triazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-azidocyclohexyl)-4-methyl-5-[1-(3-propan-2-ylphenoxy)ethyl]-1,2,4-triazole?
The IUPAC name of 3-(4-azidocyclohexyl)-4-methyl-5-[1-(3-propan-2-ylphenoxy)ethyl]-1,2,4-triazole (CID 154995557) is 3-(4-azidocyclohexyl)-4-methyl-5-[1-(3-propan-2-ylphenoxy)ethyl]-1,2,4-triazole.
What is the SMILES notation for 3-(4-azidocyclohexyl)-4-methyl-5-[1-(3-propan-2-ylphenoxy)ethyl]-1,2,4-triazole?
The canonical SMILES for 3-(4-azidocyclohexyl)-4-methyl-5-[1-(3-propan-2-ylphenoxy)ethyl]-1,2,4-triazole is CC(C)c1cccc(OC(C)c2nnc(C3CCC(N=[N+]=[N-])CC3)n2C)c1.
What is the InChIKey of 3-(4-azidocyclohexyl)-4-methyl-5-[1-(3-propan-2-ylphenoxy)ethyl]-1,2,4-triazole?
The InChIKey is OZYGLEYQHHBLKM-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H28N6O/c1-13(2)16-6-5-7-18(12-16)27-14(3)19-23-24-20(26(19)4)15-8-10-17(11-9-15)22-25-21/h5-7,12-15,17H,8-11H2,1-4H3.
What are the key properties of 3-(4-azidocyclohexyl)-4-methyl-5-[1-(3-propan-2-ylphenoxy)ethyl]-1,2,4-triazole?
3-(4-azidocyclohexyl)-4-methyl-5-[1-(3-propan-2-ylphenoxy)ethyl]-1,2,4-triazole has a molecular weight of 368.49 g/mol, XLogP of 5.41, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-azidocyclohexyl)-4-methyl-5-[1-(3-propan-2-ylphenoxy)ethyl]-1,2,4-triazole is sourced from PubChem (CID 154995557), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).